C17H16F6N6 — CID 90466129
2-N,4-N-bis(3,3-difluorocyclobutyl)-6-[6-(difluoromethyl)-2-pyridinyl]-1,3,5-triazine-2,4-diamine (PubChem CID 90466129) has the molecular formula C17H16F6N6 and a molecular weight of 418.35 g/mol. Its IUPAC name is 2-N,4-N-bis(3,3-difluorocyclobutyl)-6-[6-(difluoromethyl)-2-pyridinyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,4-N-bis(3,3-difluorocyclobutyl)-6-[6-(difluoromethyl)-2-pyridinyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 90466129 |
| Molecular Formula | C17H16F6N6 |
| Molecular Weight | 418.35 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | 2-N,4-N-bis(3,3-difluorocyclobutyl)-6-[6-(difluoromethyl)-2-pyridinyl]-1,3,5-triazine-2,4-diamine |
| SMILES | FC(F)c1cccc(-c2nc(NC3CC(F)(F)C3)nc(NC3CC(F)(F)C3)n2)n1 |
| InChI | InChI=1S/C17H16F6N6/c18-12(19)10-2-1-3-11(26-10)13-27-14(24-8-4-16(20,21)5-8)29-15(28-13)25-9-6-17(22,23)7-9/h1-3,8-9,12H,4-7H2,(H2,24,25,27,28,29) |
| InChIKey | CMDVCIGBLUTSCG-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.35 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |