C20H18N4O3 — CID 90466145
7-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methyl-11-pyridin-3-yl-9-oxa-1,2-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-3-one (PubChem CID 90466145) has the molecular formula C20H18N4O3 and a molecular weight of 362.39 g/mol. Its IUPAC name is 7-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methyl-11-pyridin-3-yl-9-oxa-1,2-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-3-one.
| Compound Name | 7-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methyl-11-pyridin-3-yl-9-oxa-1,2-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-3-one |
|---|---|
| PubChem CID | 90466145 |
| Molecular Formula | C20H18N4O3 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 7-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methyl-11-pyridin-3-yl-9-oxa-1,2-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-3-one |
| SMILES | Cc1noc(C)c1-c1ccc2c(=O)n(C)n3c2c1OCC3c1cccnc1 |
| InChI | InChI=1S/C20H18N4O3/c1-11-17(12(2)27-22-11)14-6-7-15-18-19(14)26-10-16(13-5-4-8-21-9-13)24(18)23(3)20(15)25/h4-9,16H,10H2,1-3H3 |
| InChIKey | JIWZXZCQZJYFQM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 75.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |