C20H16N2O2S — CID 90466196
6-(3,4-dimethoxyphenyl)-3-phenyl-[1,2]thiazolo[4,3-b]pyridine (PubChem CID 90466196) has the molecular formula C20H16N2O2S and a molecular weight of 348.43 g/mol. Its IUPAC name is 6-(3,4-dimethoxyphenyl)-3-phenyl-[1,2]thiazolo[4,3-b]pyridine.
| Compound Name | 6-(3,4-dimethoxyphenyl)-3-phenyl-[1,2]thiazolo[4,3-b]pyridine |
|---|---|
| PubChem CID | 90466196 |
| Molecular Formula | C20H16N2O2S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 6-(3,4-dimethoxyphenyl)-3-phenyl-[1,2]thiazolo[4,3-b]pyridine |
| SMILES | COc1ccc(-c2cnc3c(-c4ccccc4)snc3c2)cc1OC |
| InChI | InChI=1S/C20H16N2O2S/c1-23-17-9-8-14(11-18(17)24-2)15-10-16-19(21-12-15)20(25-22-16)13-6-4-3-5-7-13/h3-12H,1-2H3 |
| InChIKey | ZWFWTFGQYJINLL-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |