C22H29F4N7O — CID 90466269
2-N,4-N-bis(4,4-difluorocyclohexyl)-6-[4-(2-methoxyethyl)pyrimidin-2-yl]-1,3,5-triazine-2,4-diamine (PubChem CID 90466269) has the molecular formula C22H29F4N7O and a molecular weight of 483.51 g/mol. Its IUPAC name is 2-N,4-N-bis(4,4-difluorocyclohexyl)-6-[4-(2-methoxyethyl)pyrimidin-2-yl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,4-N-bis(4,4-difluorocyclohexyl)-6-[4-(2-methoxyethyl)pyrimidin-2-yl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 90466269 |
| Molecular Formula | C22H29F4N7O |
| Molecular Weight | 483.51 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | 2-N,4-N-bis(4,4-difluorocyclohexyl)-6-[4-(2-methoxyethyl)pyrimidin-2-yl]-1,3,5-triazine-2,4-diamine |
| SMILES | COCCc1ccnc(-c2nc(NC3CCC(F)(F)CC3)nc(NC3CCC(F)(F)CC3)n2)n1 |
| InChI | InChI=1S/C22H29F4N7O/c1-34-13-7-16-6-12-27-17(28-16)18-31-19(29-14-2-8-21(23,24)9-3-14)33-20(32-18)30-15-4-10-22(25,26)11-5-15/h6,12,14-15H,2-5,7-11,13H2,1H3,(H2,29,30,31,32,33) |
| InChIKey | IIDRMKULCOPTDM-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.51 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |