C20H23F6N7 — CID 90466270
2-N,4-N-bis(4,4-difluorocyclohexyl)-6-[4-(difluoromethyl)pyrimidin-2-yl]-1,3,5-triazine-2,4-diamine (PubChem CID 90466270) has the molecular formula C20H23F6N7 and a molecular weight of 475.44 g/mol. Its IUPAC name is 2-N,4-N-bis(4,4-difluorocyclohexyl)-6-[4-(difluoromethyl)pyrimidin-2-yl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,4-N-bis(4,4-difluorocyclohexyl)-6-[4-(difluoromethyl)pyrimidin-2-yl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 90466270 |
| Molecular Formula | C20H23F6N7 |
| Molecular Weight | 475.44 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | 2-N,4-N-bis(4,4-difluorocyclohexyl)-6-[4-(difluoromethyl)pyrimidin-2-yl]-1,3,5-triazine-2,4-diamine |
| SMILES | FC(F)c1ccnc(-c2nc(NC3CCC(F)(F)CC3)nc(NC3CCC(F)(F)CC3)n2)n1 |
| InChI | InChI=1S/C20H23F6N7/c21-14(22)13-5-10-27-15(30-13)16-31-17(28-11-1-6-19(23,24)7-2-11)33-18(32-16)29-12-3-8-20(25,26)9-4-12/h5,10-12,14H,1-4,6-9H2,(H2,28,29,31,32,33) |
| InChIKey | KCKMAAKVFCQNEN-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.44 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |