About methyl 4-[1-[(5,7-dimethyl-1H-indol-4-yl)methyl]-4-methoxypiperidin-2-yl]benzoate
methyl 4-[1-[(5,7-dimethyl-1H-indol-4-yl)methyl]-4-methoxypiperidin-2-yl]benzoate (PubChem CID 90466307) has the molecular formula C25H30N2O3
and a molecular weight of 406.53 g/mol. Its IUPAC name is methyl 4-[1-[(5,7-dimethyl-1H-indol-4-yl)methyl]-4-methoxypiperidin-2-yl]benzoate.
Molecular Properties
| Compound Name | methyl 4-[1-[(5,7-dimethyl-1H-indol-4-yl)methyl]-4-methoxypiperidin-2-yl]benzoate |
| PubChem CID | 90466307 |
| Molecular Formula | C25H30N2O3 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | methyl 4-[1-[(5,7-dimethyl-1H-indol-4-yl)methyl]-4-methoxypiperidin-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2CC(OC)CCN2Cc2c(C)cc(C)c3[nH]ccc23)cc1 |
| InChI | InChI=1S/C25H30N2O3/c1-16-13-17(2)24-21(9-11-26-24)22(16)15-27-12-10-20(29-3)14-23(27)18-5-7-19(8-6-18)25(28)30-4/h5-9,11,13,20,23,26H,10,12,14-15H2,1-4H3 |
| InChIKey | LQKVPCAARROACY-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 4-[1-[(5,7-dimethyl-1H-indol-4-yl)methyl]-4-methoxypiperidin-2-yl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[1-[(5,7-dimethyl-1H-indol-4-yl)methyl]-4-methoxypiperidin-2-yl]benzoate?
The IUPAC name of methyl 4-[1-[(5,7-dimethyl-1H-indol-4-yl)methyl]-4-methoxypiperidin-2-yl]benzoate (CID 90466307) is methyl 4-[1-[(5,7-dimethyl-1H-indol-4-yl)methyl]-4-methoxypiperidin-2-yl]benzoate.
What is the SMILES notation for methyl 4-[1-[(5,7-dimethyl-1H-indol-4-yl)methyl]-4-methoxypiperidin-2-yl]benzoate?
The canonical SMILES for methyl 4-[1-[(5,7-dimethyl-1H-indol-4-yl)methyl]-4-methoxypiperidin-2-yl]benzoate is COC(=O)c1ccc(C2CC(OC)CCN2Cc2c(C)cc(C)c3[nH]ccc23)cc1.
What is the InChIKey of methyl 4-[1-[(5,7-dimethyl-1H-indol-4-yl)methyl]-4-methoxypiperidin-2-yl]benzoate?
The InChIKey is LQKVPCAARROACY-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H30N2O3/c1-16-13-17(2)24-21(9-11-26-24)22(16)15-27-12-10-20(29-3)14-23(27)18-5-7-19(8-6-18)25(28)30-4/h5-9,11,13,20,23,26H,10,12,14-15H2,1-4H3.
What are the key properties of methyl 4-[1-[(5,7-dimethyl-1H-indol-4-yl)methyl]-4-methoxypiperidin-2-yl]benzoate?
methyl 4-[1-[(5,7-dimethyl-1H-indol-4-yl)methyl]-4-methoxypiperidin-2-yl]benzoate has a molecular weight of 406.53 g/mol, XLogP of 4.92, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[1-[(5,7-dimethyl-1H-indol-4-yl)methyl]-4-methoxypiperidin-2-yl]benzoate is sourced from PubChem (CID 90466307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).