C29H33BrN2O4 — CID 90466442
methyl (E)-2-[(1R,6R,7S)-1'-[(4-bromophenyl)methyl]-6-ethyl-2'-oxospiro[3,5,6,7,8,8a-hexahydro-2H-indolizine-1,3'-indole]-7-yl]-3-methoxyprop-2-enoate (PubChem CID 90466442) has the molecular formula C29H33BrN2O4 and a molecular weight of 553.50 g/mol. Its IUPAC name is methyl (E)-2-[(1R,6R,7S)-1'-[(4-bromophenyl)methyl]-6-ethyl-2'-oxospiro[3,5,6,7,8,8a-hexahydro-2H-indolizine-1,3'-indole]-7-yl]-3-methoxyprop-2-enoate.
| Compound Name | methyl (E)-2-[(1R,6R,7S)-1'-[(4-bromophenyl)methyl]-6-ethyl-2'-oxospiro[3,5,6,7,8,8a-hexahydro-2H-indolizine-1,3'-indole]-7-yl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 90466442 |
| Molecular Formula | C29H33BrN2O4 |
| Molecular Weight | 553.50 g/mol |
| Exact Mass | 552.16 |
| IUPAC Name | methyl (E)-2-[(1R,6R,7S)-1'-[(4-bromophenyl)methyl]-6-ethyl-2'-oxospiro[3,5,6,7,8,8a-hexahydro-2H-indolizine-1,3'-indole]-7-yl]-3-methoxyprop-2-enoate |
| SMILES | CC[C@H]1CN2CC[C@]3(C(=O)N(Cc4ccc(Br)cc4)c4ccccc43)C2C[C@@H]1/C(=C\OC)C(=O)OC |
| InChI | InChI=1S/C29H33BrN2O4/c1-4-20-17-31-14-13-29(26(31)15-22(20)23(18-35-2)27(33)36-3)24-7-5-6-8-25(24)32(28(29)34)16-19-9-11-21(30)12-10-19/h5-12,18,20,22,26H,4,13-17H2,1-3H3/b23-18+/t20-,22-,26?,29+/m0/s1 |
| InChIKey | IDUGVWOXDDOVQP-FNEOIRBMSA-N |
| XLogP | 5.06 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.50 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|