About 4-[1-[(5,7-dimethyl-1H-indol-4-yl)methyl]piperidin-2-yl]benzoic acid
4-[1-[(5,7-dimethyl-1H-indol-4-yl)methyl]piperidin-2-yl]benzoic acid (PubChem CID 90466447) has the molecular formula C23H26N2O2
and a molecular weight of 362.47 g/mol. Its IUPAC name is 4-[1-[(5,7-dimethyl-1H-indol-4-yl)methyl]piperidin-2-yl]benzoic acid.
Molecular Properties
| Compound Name | 4-[1-[(5,7-dimethyl-1H-indol-4-yl)methyl]piperidin-2-yl]benzoic acid |
| PubChem CID | 90466447 |
| Molecular Formula | C23H26N2O2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 4-[1-[(5,7-dimethyl-1H-indol-4-yl)methyl]piperidin-2-yl]benzoic acid |
| SMILES | Cc1cc(C)c2[nH]ccc2c1CN1CCCCC1c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C23H26N2O2/c1-15-13-16(2)22-19(10-11-24-22)20(15)14-25-12-4-3-5-21(25)17-6-8-18(9-7-17)23(26)27/h6-11,13,21,24H,3-5,12,14H2,1-2H3,(H,26,27) |
| InChIKey | OTSLYLLOBTYVLP-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[1-[(5,7-dimethyl-1H-indol-4-yl)methyl]piperidin-2-yl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-[(5,7-dimethyl-1H-indol-4-yl)methyl]piperidin-2-yl]benzoic acid?
The IUPAC name of 4-[1-[(5,7-dimethyl-1H-indol-4-yl)methyl]piperidin-2-yl]benzoic acid (CID 90466447) is 4-[1-[(5,7-dimethyl-1H-indol-4-yl)methyl]piperidin-2-yl]benzoic acid.
What is the SMILES notation for 4-[1-[(5,7-dimethyl-1H-indol-4-yl)methyl]piperidin-2-yl]benzoic acid?
The canonical SMILES for 4-[1-[(5,7-dimethyl-1H-indol-4-yl)methyl]piperidin-2-yl]benzoic acid is Cc1cc(C)c2[nH]ccc2c1CN1CCCCC1c1ccc(C(=O)O)cc1.
What is the InChIKey of 4-[1-[(5,7-dimethyl-1H-indol-4-yl)methyl]piperidin-2-yl]benzoic acid?
The InChIKey is OTSLYLLOBTYVLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26N2O2/c1-15-13-16(2)22-19(10-11-24-22)20(15)14-25-12-4-3-5-21(25)17-6-8-18(9-7-17)23(26)27/h6-11,13,21,24H,3-5,12,14H2,1-2H3,(H,26,27).
What are the key properties of 4-[1-[(5,7-dimethyl-1H-indol-4-yl)methyl]piperidin-2-yl]benzoic acid?
4-[1-[(5,7-dimethyl-1H-indol-4-yl)methyl]piperidin-2-yl]benzoic acid has a molecular weight of 362.47 g/mol, XLogP of 5.21, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-[(5,7-dimethyl-1H-indol-4-yl)methyl]piperidin-2-yl]benzoic acid is sourced from PubChem (CID 90466447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).