C23H21FN6O2S — CID 90466482
(5Z)-5-[[4-[4-(4-ethylpiperazin-1-yl)-3-fluorophenyl]pyrido[3,4-d]pyrimidin-6-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 90466482) has the molecular formula C23H21FN6O2S and a molecular weight of 464.53 g/mol. Its IUPAC name is (5Z)-5-[[4-[4-(4-ethylpiperazin-1-yl)-3-fluorophenyl]pyrido[3,4-d]pyrimidin-6-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[4-[4-(4-ethylpiperazin-1-yl)-3-fluorophenyl]pyrido[3,4-d]pyrimidin-6-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 90466482 |
| Molecular Formula | C23H21FN6O2S |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | (5Z)-5-[[4-[4-(4-ethylpiperazin-1-yl)-3-fluorophenyl]pyrido[3,4-d]pyrimidin-6-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CCN1CCN(c2ccc(-c3ncnc4cnc(/C=C5\SC(=O)NC5=O)cc34)cc2F)CC1 |
| InChI | InChI=1S/C23H21FN6O2S/c1-2-29-5-7-30(8-6-29)19-4-3-14(9-17(19)24)21-16-10-15(25-12-18(16)26-13-27-21)11-20-22(31)28-23(32)33-20/h3-4,9-13H,2,5-8H2,1H3,(H,28,31,32)/b20-11- |
| InChIKey | NPBPUEZAHNUUTK-JAIQZWGSSA-N |
| XLogP | 3.30 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|