C23H17Cl2N5O — CID 90466503
(Z)-2-(2,6-dichlorophenyl)-3-[5-[1-(oxolan-3-yl)pyrazol-4-yl]-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enenitrile (PubChem CID 90466503) has the molecular formula C23H17Cl2N5O and a molecular weight of 450.33 g/mol. Its IUPAC name is (Z)-2-(2,6-dichlorophenyl)-3-[5-[1-(oxolan-3-yl)pyrazol-4-yl]-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enenitrile.
| Compound Name | (Z)-2-(2,6-dichlorophenyl)-3-[5-[1-(oxolan-3-yl)pyrazol-4-yl]-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 90466503 |
| Molecular Formula | C23H17Cl2N5O |
| Molecular Weight | 450.33 g/mol |
| Exact Mass | 449.08 |
| IUPAC Name | (Z)-2-(2,6-dichlorophenyl)-3-[5-[1-(oxolan-3-yl)pyrazol-4-yl]-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enenitrile |
| SMILES | N#C/C(=C\c1c[nH]c2ncc(-c3cnn(C4CCOC4)c3)cc12)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C23H17Cl2N5O/c24-20-2-1-3-21(25)22(20)14(8-26)6-16-10-28-23-19(16)7-15(9-27-23)17-11-29-30(12-17)18-4-5-31-13-18/h1-3,6-7,9-12,18H,4-5,13H2,(H,27,28)/b14-6+ |
| InChIKey | AEDQOUGFJNXICO-MKMNVTDBSA-N |
| XLogP | 5.76 |
| TPSA | 79.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.33 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|