C26H16Cl2N4O — CID 90466656
(Z)-2-(2,6-dichlorophenyl)-3-[5-(7-methoxyquinolin-3-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enenitrile (PubChem CID 90466656) has the molecular formula C26H16Cl2N4O and a molecular weight of 471.35 g/mol. Its IUPAC name is (Z)-2-(2,6-dichlorophenyl)-3-[5-(7-methoxyquinolin-3-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enenitrile.
| Compound Name | (Z)-2-(2,6-dichlorophenyl)-3-[5-(7-methoxyquinolin-3-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 90466656 |
| Molecular Formula | C26H16Cl2N4O |
| Molecular Weight | 471.35 g/mol |
| Exact Mass | 470.07 |
| IUPAC Name | (Z)-2-(2,6-dichlorophenyl)-3-[5-(7-methoxyquinolin-3-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enenitrile |
| SMILES | COc1ccc2cc(-c3cnc4[nH]cc(/C=C(\C#N)c5c(Cl)cccc5Cl)c4c3)cnc2c1 |
| InChI | InChI=1S/C26H16Cl2N4O/c1-33-20-6-5-15-7-17(12-30-24(15)10-20)18-9-21-19(14-32-26(21)31-13-18)8-16(11-29)25-22(27)3-2-4-23(25)28/h2-10,12-14H,1H3,(H,31,32)/b16-8+ |
| InChIKey | ASCHQPXJJYJTEM-LZYBPNLTSA-N |
| XLogP | 7.16 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.35 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|