C23H32O5 — CID 90466944
(6a,9-diformyl-5,5-dimethyl-3-oxo-1,2,4,4a,6,7,10,11,11a,11b-decahydrocyclohepta[a]naphthalen-7-yl) butanoate (PubChem CID 90466944) has the molecular formula C23H32O5 and a molecular weight of 388.50 g/mol. Its IUPAC name is (6a,9-diformyl-5,5-dimethyl-3-oxo-1,2,4,4a,6,7,10,11,11a,11b-decahydrocyclohepta[a]naphthalen-7-yl) butanoate.
| Compound Name | (6a,9-diformyl-5,5-dimethyl-3-oxo-1,2,4,4a,6,7,10,11,11a,11b-decahydrocyclohepta[a]naphthalen-7-yl) butanoate |
|---|---|
| PubChem CID | 90466944 |
| Molecular Formula | C23H32O5 |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | (6a,9-diformyl-5,5-dimethyl-3-oxo-1,2,4,4a,6,7,10,11,11a,11b-decahydrocyclohepta[a]naphthalen-7-yl) butanoate |
| SMILES | CCCC(=O)OC1C=C(C=O)CCC2C3CCC(=O)CC3C(C)(C)CC12C=O |
| InChI | InChI=1S/C23H32O5/c1-4-5-21(27)28-20-10-15(12-24)6-9-18-17-8-7-16(26)11-19(17)22(2,3)13-23(18,20)14-25/h10,12,14,17-20H,4-9,11,13H2,1-3H3 |
| InChIKey | YAZWDQKQPBWTCG-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|