About 5-[(E)-2-(2,4-difluorophenyl)sulfonylethenyl]-N-methyl-2-methylsulfanylpyrimidin-4-amine
5-[(E)-2-(2,4-difluorophenyl)sulfonylethenyl]-N-methyl-2-methylsulfanylpyrimidin-4-amine (PubChem CID 90467082) has the molecular formula C14H13F2N3O2S2
and a molecular weight of 357.41 g/mol. Its IUPAC name is 5-[(E)-2-(2,4-difluorophenyl)sulfonylethenyl]-N-methyl-2-methylsulfanylpyrimidin-4-amine.
Molecular Properties
| Compound Name | 5-[(E)-2-(2,4-difluorophenyl)sulfonylethenyl]-N-methyl-2-methylsulfanylpyrimidin-4-amine |
| PubChem CID | 90467082 |
| Molecular Formula | C14H13F2N3O2S2 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | 5-[(E)-2-(2,4-difluorophenyl)sulfonylethenyl]-N-methyl-2-methylsulfanylpyrimidin-4-amine |
| SMILES | CNc1nc(SC)ncc1/C=C/S(=O)(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C14H13F2N3O2S2/c1-17-13-9(8-18-14(19-13)22-2)5-6-23(20,21)12-4-3-10(15)7-11(12)16/h3-8H,1-2H3,(H,17,18,19)/b6-5+ |
| InChIKey | DRCOZZXMXYBNQD-AATRIKPKSA-N |
| XLogP | 2.96 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[(E)-2-(2,4-difluorophenyl)sulfonylethenyl]-N-methyl-2-methylsulfanylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(E)-2-(2,4-difluorophenyl)sulfonylethenyl]-N-methyl-2-methylsulfanylpyrimidin-4-amine?
The IUPAC name of 5-[(E)-2-(2,4-difluorophenyl)sulfonylethenyl]-N-methyl-2-methylsulfanylpyrimidin-4-amine (CID 90467082) is 5-[(E)-2-(2,4-difluorophenyl)sulfonylethenyl]-N-methyl-2-methylsulfanylpyrimidin-4-amine.
What is the SMILES notation for 5-[(E)-2-(2,4-difluorophenyl)sulfonylethenyl]-N-methyl-2-methylsulfanylpyrimidin-4-amine?
The canonical SMILES for 5-[(E)-2-(2,4-difluorophenyl)sulfonylethenyl]-N-methyl-2-methylsulfanylpyrimidin-4-amine is CNc1nc(SC)ncc1/C=C/S(=O)(=O)c1ccc(F)cc1F.
What is the InChIKey of 5-[(E)-2-(2,4-difluorophenyl)sulfonylethenyl]-N-methyl-2-methylsulfanylpyrimidin-4-amine?
The InChIKey is DRCOZZXMXYBNQD-AATRIKPKSA-N. The full InChI is InChI=1S/C14H13F2N3O2S2/c1-17-13-9(8-18-14(19-13)22-2)5-6-23(20,21)12-4-3-10(15)7-11(12)16/h3-8H,1-2H3,(H,17,18,19)/b6-5+.
What are the key properties of 5-[(E)-2-(2,4-difluorophenyl)sulfonylethenyl]-N-methyl-2-methylsulfanylpyrimidin-4-amine?
5-[(E)-2-(2,4-difluorophenyl)sulfonylethenyl]-N-methyl-2-methylsulfanylpyrimidin-4-amine has a molecular weight of 357.41 g/mol, XLogP of 2.96, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(E)-2-(2,4-difluorophenyl)sulfonylethenyl]-N-methyl-2-methylsulfanylpyrimidin-4-amine is sourced from PubChem (CID 90467082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).