C27H21N7O2 — CID 90467335
5-[4-[5-(2-pyridin-3-ylethyl)tetrazol-1-yl]phenyl]-1H-benzo[g][1,5]benzodiazepine-2,4-dione (PubChem CID 90467335) has the molecular formula C27H21N7O2 and a molecular weight of 475.51 g/mol. Its IUPAC name is 5-[4-[5-(2-pyridin-3-ylethyl)tetrazol-1-yl]phenyl]-1H-benzo[g][1,5]benzodiazepine-2,4-dione.
| Compound Name | 5-[4-[5-(2-pyridin-3-ylethyl)tetrazol-1-yl]phenyl]-1H-benzo[g][1,5]benzodiazepine-2,4-dione |
|---|---|
| PubChem CID | 90467335 |
| Molecular Formula | C27H21N7O2 |
| Molecular Weight | 475.51 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | 5-[4-[5-(2-pyridin-3-ylethyl)tetrazol-1-yl]phenyl]-1H-benzo[g][1,5]benzodiazepine-2,4-dione |
| SMILES | O=C1CC(=O)N(c2ccc(-n3nnnc3CCc3cccnc3)cc2)c2ccc3ccccc3c2N1 |
| InChI | InChI=1S/C27H21N7O2/c35-25-16-26(36)33(23-13-8-19-5-1-2-6-22(19)27(23)29-25)20-9-11-21(12-10-20)34-24(30-31-32-34)14-7-18-4-3-15-28-17-18/h1-6,8-13,15,17H,7,14,16H2,(H,29,35) |
| InChIKey | CGLMUUHFODGYRZ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 105.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.51 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|