C21H21Cl2N3O3S — CID 90467560
7,8-dichloro-4-methylpyrrolo[1,2-a]quinoxalin-5-ium-5-amine;2,4,6-trimethylbenzenesulfonate (PubChem CID 90467560) has the molecular formula C21H21Cl2N3O3S and a molecular weight of 466.39 g/mol. Its IUPAC name is 7,8-dichloro-4-methylpyrrolo[1,2-a]quinoxalin-5-ium-5-amine;2,4,6-trimethylbenzenesulfonate.
| Compound Name | 7,8-dichloro-4-methylpyrrolo[1,2-a]quinoxalin-5-ium-5-amine;2,4,6-trimethylbenzenesulfonate |
|---|---|
| PubChem CID | 90467560 |
| Molecular Formula | C21H21Cl2N3O3S |
| Molecular Weight | 466.39 g/mol |
| Exact Mass | 465.07 |
| IUPAC Name | 7,8-dichloro-4-methylpyrrolo[1,2-a]quinoxalin-5-ium-5-amine;2,4,6-trimethylbenzenesulfonate |
| SMILES | Cc1c2cccn2c2cc(Cl)c(Cl)cc2[n+]1N.Cc1cc(C)c(S(=O)(=O)[O-])c(C)c1 |
| InChI | InChI=1S/C12H10Cl2N3.C9H12O3S/c1-7-10-3-2-4-16(10)11-5-8(13)9(14)6-12(11)17(7)15;1-6-4-7(2)9(8(3)5-6)13(10,11)12/h2-6H,15H2,1H3;4-5H,1-3H3,(H,10,11,12)/q+1;/p-1 |
| InChIKey | JQZOSBBHUZZLCV-UHFFFAOYSA-M |
| XLogP | 4.22 |
| TPSA | 91.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.39 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|