C19H33NO — CID 90467670
9-(aminomethyl)-4,4,11b-trimethyl-2,3,4a,5,6,6a,7,8,11,11a-decahydro-1H-cyclohepta[a]naphthalen-7-ol (PubChem CID 90467670) has the molecular formula C19H33NO and a molecular weight of 291.48 g/mol. Its IUPAC name is 9-(aminomethyl)-4,4,11b-trimethyl-2,3,4a,5,6,6a,7,8,11,11a-decahydro-1H-cyclohepta[a]naphthalen-7-ol.
| Compound Name | 9-(aminomethyl)-4,4,11b-trimethyl-2,3,4a,5,6,6a,7,8,11,11a-decahydro-1H-cyclohepta[a]naphthalen-7-ol |
|---|---|
| PubChem CID | 90467670 |
| Molecular Formula | C19H33NO |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.26 |
| IUPAC Name | 9-(aminomethyl)-4,4,11b-trimethyl-2,3,4a,5,6,6a,7,8,11,11a-decahydro-1H-cyclohepta[a]naphthalen-7-ol |
| SMILES | CC1(C)CCCC2(C)C3CC=C(CN)CC(O)C3CCC12 |
| InChI | InChI=1S/C19H33NO/c1-18(2)9-4-10-19(3)15-7-5-13(12-20)11-16(21)14(15)6-8-17(18)19/h5,14-17,21H,4,6-12,20H2,1-3H3 |
| InChIKey | AJSMULHXNJDKFB-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|