About 6-phenyl-[1,2]thiazolo[4,3-b]pyridin-3-amine
6-phenyl-[1,2]thiazolo[4,3-b]pyridin-3-amine (PubChem CID 90467780) has the molecular formula C12H9N3S
and a molecular weight of 227.29 g/mol. Its IUPAC name is 6-phenyl-[1,2]thiazolo[4,3-b]pyridin-3-amine.
Molecular Properties
| Compound Name | 6-phenyl-[1,2]thiazolo[4,3-b]pyridin-3-amine |
| PubChem CID | 90467780 |
| Molecular Formula | C12H9N3S |
| Molecular Weight | 227.29 g/mol |
| Exact Mass | 227.05 |
| IUPAC Name | 6-phenyl-[1,2]thiazolo[4,3-b]pyridin-3-amine |
| SMILES | Nc1snc2cc(-c3ccccc3)cnc12 |
| InChI | InChI=1S/C12H9N3S/c13-12-11-10(15-16-12)6-9(7-14-11)8-4-2-1-3-5-8/h1-7H,13H2 |
| InChIKey | PIXIUHWPNRGQIU-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.29 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-phenyl-[1,2]thiazolo[4,3-b]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-phenyl-[1,2]thiazolo[4,3-b]pyridin-3-amine?
The IUPAC name of 6-phenyl-[1,2]thiazolo[4,3-b]pyridin-3-amine (CID 90467780) is 6-phenyl-[1,2]thiazolo[4,3-b]pyridin-3-amine.
What is the SMILES notation for 6-phenyl-[1,2]thiazolo[4,3-b]pyridin-3-amine?
The canonical SMILES for 6-phenyl-[1,2]thiazolo[4,3-b]pyridin-3-amine is Nc1snc2cc(-c3ccccc3)cnc12.
What is the InChIKey of 6-phenyl-[1,2]thiazolo[4,3-b]pyridin-3-amine?
The InChIKey is PIXIUHWPNRGQIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N3S/c13-12-11-10(15-16-12)6-9(7-14-11)8-4-2-1-3-5-8/h1-7H,13H2.
What are the key properties of 6-phenyl-[1,2]thiazolo[4,3-b]pyridin-3-amine?
6-phenyl-[1,2]thiazolo[4,3-b]pyridin-3-amine has a molecular weight of 227.29 g/mol, XLogP of 2.94, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-phenyl-[1,2]thiazolo[4,3-b]pyridin-3-amine is sourced from PubChem (CID 90467780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).