About 4-(6-thiophen-2-yl-[1,2]thiazolo[4,3-b]pyridin-3-yl)morpholine
4-(6-thiophen-2-yl-[1,2]thiazolo[4,3-b]pyridin-3-yl)morpholine (PubChem CID 90467785) has the molecular formula C14H13N3OS2
and a molecular weight of 303.41 g/mol. Its IUPAC name is 4-(6-thiophen-2-yl-[1,2]thiazolo[4,3-b]pyridin-3-yl)morpholine.
Molecular Properties
| Compound Name | 4-(6-thiophen-2-yl-[1,2]thiazolo[4,3-b]pyridin-3-yl)morpholine |
| PubChem CID | 90467785 |
| Molecular Formula | C14H13N3OS2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | 4-(6-thiophen-2-yl-[1,2]thiazolo[4,3-b]pyridin-3-yl)morpholine |
| SMILES | c1csc(-c2cnc3c(N4CCOCC4)snc3c2)c1 |
| InChI | InChI=1S/C14H13N3OS2/c1-2-12(19-7-1)10-8-11-13(15-9-10)14(20-16-11)17-3-5-18-6-4-17/h1-2,7-9H,3-6H2 |
| InChIKey | UCBNBUVBGNUKDD-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(6-thiophen-2-yl-[1,2]thiazolo[4,3-b]pyridin-3-yl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6-thiophen-2-yl-[1,2]thiazolo[4,3-b]pyridin-3-yl)morpholine?
The IUPAC name of 4-(6-thiophen-2-yl-[1,2]thiazolo[4,3-b]pyridin-3-yl)morpholine (CID 90467785) is 4-(6-thiophen-2-yl-[1,2]thiazolo[4,3-b]pyridin-3-yl)morpholine.
What is the SMILES notation for 4-(6-thiophen-2-yl-[1,2]thiazolo[4,3-b]pyridin-3-yl)morpholine?
The canonical SMILES for 4-(6-thiophen-2-yl-[1,2]thiazolo[4,3-b]pyridin-3-yl)morpholine is c1csc(-c2cnc3c(N4CCOCC4)snc3c2)c1.
What is the InChIKey of 4-(6-thiophen-2-yl-[1,2]thiazolo[4,3-b]pyridin-3-yl)morpholine?
The InChIKey is UCBNBUVBGNUKDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N3OS2/c1-2-12(19-7-1)10-8-11-13(15-9-10)14(20-16-11)17-3-5-18-6-4-17/h1-2,7-9H,3-6H2.
What are the key properties of 4-(6-thiophen-2-yl-[1,2]thiazolo[4,3-b]pyridin-3-yl)morpholine?
4-(6-thiophen-2-yl-[1,2]thiazolo[4,3-b]pyridin-3-yl)morpholine has a molecular weight of 303.41 g/mol, XLogP of 3.26, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6-thiophen-2-yl-[1,2]thiazolo[4,3-b]pyridin-3-yl)morpholine is sourced from PubChem (CID 90467785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).