C25H31ClN4O5 — CID 90468014
(2,5-dioxopyrrolidin-1-yl) 2-[[2-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-4-chlorophenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate (PubChem CID 90468014) has the molecular formula C25H31ClN4O5 and a molecular weight of 503.00 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-[[2-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-4-chlorophenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-[[2-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-4-chlorophenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 90468014 |
| Molecular Formula | C25H31ClN4O5 |
| Molecular Weight | 503.00 g/mol |
| Exact Mass | 502.20 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-[[2-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-4-chlorophenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
| SMILES | O=C(ON1C(=O)CCC1=O)N1CC2CN(Cc3ccc(Cl)cc3N3CCOC4CCCC43)CC2C1 |
| InChI | InChI=1S/C25H31ClN4O5/c26-19-5-4-16(21(10-19)29-8-9-34-22-3-1-2-20(22)29)11-27-12-17-14-28(15-18(17)13-27)25(33)35-30-23(31)6-7-24(30)32/h4-5,10,17-18,20,22H,1-3,6-9,11-15H2 |
| InChIKey | DPHAFPXTGZGLRH-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 82.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.00 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|