About [1-[(5,7-dimethyl-1H-indol-4-yl)methyl]-2-phenylpiperidin-4-yl]methanol
[1-[(5,7-dimethyl-1H-indol-4-yl)methyl]-2-phenylpiperidin-4-yl]methanol (PubChem CID 90468038) has the molecular formula C23H28N2O
and a molecular weight of 348.49 g/mol. Its IUPAC name is [1-[(5,7-dimethyl-1H-indol-4-yl)methyl]-2-phenylpiperidin-4-yl]methanol.
Molecular Properties
| Compound Name | [1-[(5,7-dimethyl-1H-indol-4-yl)methyl]-2-phenylpiperidin-4-yl]methanol |
| PubChem CID | 90468038 |
| Molecular Formula | C23H28N2O |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | [1-[(5,7-dimethyl-1H-indol-4-yl)methyl]-2-phenylpiperidin-4-yl]methanol |
| SMILES | Cc1cc(C)c2[nH]ccc2c1CN1CCC(CO)CC1c1ccccc1 |
| InChI | InChI=1S/C23H28N2O/c1-16-12-17(2)23-20(8-10-24-23)21(16)14-25-11-9-18(15-26)13-22(25)19-6-4-3-5-7-19/h3-8,10,12,18,22,24,26H,9,11,13-15H2,1-2H3 |
| InChIKey | GPVRSVAIVVQZMJ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 39.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [1-[(5,7-dimethyl-1H-indol-4-yl)methyl]-2-phenylpiperidin-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(5,7-dimethyl-1H-indol-4-yl)methyl]-2-phenylpiperidin-4-yl]methanol?
The IUPAC name of [1-[(5,7-dimethyl-1H-indol-4-yl)methyl]-2-phenylpiperidin-4-yl]methanol (CID 90468038) is [1-[(5,7-dimethyl-1H-indol-4-yl)methyl]-2-phenylpiperidin-4-yl]methanol.
What is the SMILES notation for [1-[(5,7-dimethyl-1H-indol-4-yl)methyl]-2-phenylpiperidin-4-yl]methanol?
The canonical SMILES for [1-[(5,7-dimethyl-1H-indol-4-yl)methyl]-2-phenylpiperidin-4-yl]methanol is Cc1cc(C)c2[nH]ccc2c1CN1CCC(CO)CC1c1ccccc1.
What is the InChIKey of [1-[(5,7-dimethyl-1H-indol-4-yl)methyl]-2-phenylpiperidin-4-yl]methanol?
The InChIKey is GPVRSVAIVVQZMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H28N2O/c1-16-12-17(2)23-20(8-10-24-23)21(16)14-25-11-9-18(15-26)13-22(25)19-6-4-3-5-7-19/h3-8,10,12,18,22,24,26H,9,11,13-15H2,1-2H3.
What are the key properties of [1-[(5,7-dimethyl-1H-indol-4-yl)methyl]-2-phenylpiperidin-4-yl]methanol?
[1-[(5,7-dimethyl-1H-indol-4-yl)methyl]-2-phenylpiperidin-4-yl]methanol has a molecular weight of 348.49 g/mol, XLogP of 4.73, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(5,7-dimethyl-1H-indol-4-yl)methyl]-2-phenylpiperidin-4-yl]methanol is sourced from PubChem (CID 90468038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).