C25H29N3O5S — CID 90468318
3-[(13S,15R)-3-hydroxy-13-methyl-4-nitro-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-(5-methyl-1,3-thiazol-2-yl)propanamide (PubChem CID 90468318) has the molecular formula C25H29N3O5S and a molecular weight of 483.59 g/mol. Its IUPAC name is 3-[(13S,15R)-3-hydroxy-13-methyl-4-nitro-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-(5-methyl-1,3-thiazol-2-yl)propanamide.
| Compound Name | 3-[(13S,15R)-3-hydroxy-13-methyl-4-nitro-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-(5-methyl-1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 90468318 |
| Molecular Formula | C25H29N3O5S |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | 3-[(13S,15R)-3-hydroxy-13-methyl-4-nitro-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-(5-methyl-1,3-thiazol-2-yl)propanamide |
| SMILES | Cc1cnc(NC(=O)CCC2CC(=O)[C@@]3(C)CCC4c5ccc(O)c([N+](=O)[O-])c5CCC4C23)s1 |
| InChI | InChI=1S/C25H29N3O5S/c1-13-12-26-24(34-13)27-21(31)8-3-14-11-20(30)25(2)10-9-16-15-6-7-19(29)23(28(32)33)18(15)5-4-17(16)22(14)25/h6-7,12,14,16-17,22,29H,3-5,8-11H2,1-2H3,(H,26,27,31)/t14?,16?,17?,22?,25-/m1/s1 |
| InChIKey | VVFQKHNNJYLAIN-QCUHKSPNSA-N |
| XLogP | 5.14 |
| TPSA | 122.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|