C23H28N5O6P — CID 90468402
benzyl (2S)-2-[[2-(2,6-diaminopyrimidin-4-yl)oxyethoxymethyl-phenoxyphosphoryl]amino]propanoate (PubChem CID 90468402) has the molecular formula C23H28N5O6P and a molecular weight of 501.48 g/mol. Its IUPAC name is benzyl (2S)-2-[[2-(2,6-diaminopyrimidin-4-yl)oxyethoxymethyl-phenoxyphosphoryl]amino]propanoate.
| Compound Name | benzyl (2S)-2-[[2-(2,6-diaminopyrimidin-4-yl)oxyethoxymethyl-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 90468402 |
| Molecular Formula | C23H28N5O6P |
| Molecular Weight | 501.48 g/mol |
| Exact Mass | 501.18 |
| IUPAC Name | benzyl (2S)-2-[[2-(2,6-diaminopyrimidin-4-yl)oxyethoxymethyl-phenoxyphosphoryl]amino]propanoate |
| SMILES | C[C@H](NP(=O)(COCCOc1cc(N)nc(N)n1)Oc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H28N5O6P/c1-17(22(29)33-15-18-8-4-2-5-9-18)28-35(30,34-19-10-6-3-7-11-19)16-31-12-13-32-21-14-20(24)26-23(25)27-21/h2-11,14,17H,12-13,15-16H2,1H3,(H,28,30)(H4,24,25,26,27)/t17-,35?/m0/s1 |
| InChIKey | BVFVVUPYNRZEMW-VCXWBMQSSA-N |
| XLogP | 2.99 |
| TPSA | 160.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.48 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|