C27H30FN2O4S- — CID 90468472
2-[(13S,15R)-2-fluoro-13-methyl-15-[3-[(5-methyl-1,3-thiazol-2-yl)amino]-3-oxopropyl]-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]acetate (PubChem CID 90468472) has the molecular formula C27H30FN2O4S- and a molecular weight of 497.61 g/mol. Its IUPAC name is 2-[(13S,15R)-2-fluoro-13-methyl-15-[3-[(5-methyl-1,3-thiazol-2-yl)amino]-3-oxopropyl]-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]acetate.
| Compound Name | 2-[(13S,15R)-2-fluoro-13-methyl-15-[3-[(5-methyl-1,3-thiazol-2-yl)amino]-3-oxopropyl]-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]acetate |
|---|---|
| PubChem CID | 90468472 |
| Molecular Formula | C27H30FN2O4S- |
| Molecular Weight | 497.61 g/mol |
| Exact Mass | 497.19 |
| IUPAC Name | 2-[(13S,15R)-2-fluoro-13-methyl-15-[3-[(5-methyl-1,3-thiazol-2-yl)amino]-3-oxopropyl]-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]acetate |
| SMILES | Cc1cnc(NC(=O)CCC2CC(=O)[C@@]3(C)CCC4c5cc(F)c(CC(=O)[O-])cc5CCC4C23)s1 |
| InChI | InChI=1S/C27H31FN2O4S/c1-14-13-29-26(35-14)30-23(32)6-4-16-10-22(31)27(2)8-7-18-19(25(16)27)5-3-15-9-17(11-24(33)34)21(28)12-20(15)18/h9,12-13,16,18-19,25H,3-8,10-11H2,1-2H3,(H,33,34)(H,29,30,32)/p-1/t16?,18?,19?,25?,27-/m1/s1 |
| InChIKey | QUBILIQDZOTNLV-RGFFFHTASA-M |
| XLogP | 3.95 |
| TPSA | 99.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.61 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |