About 5-[3-[3,5-bis(trifluoromethyl)phenyl]-5-chlorophenyl]-2H-triazole-4-carbonitrile
5-[3-[3,5-bis(trifluoromethyl)phenyl]-5-chlorophenyl]-2H-triazole-4-carbonitrile (PubChem CID 90468610) has the molecular formula C17H7ClF6N4
and a molecular weight of 416.71 g/mol. Its IUPAC name is 5-[3-[3,5-bis(trifluoromethyl)phenyl]-5-chlorophenyl]-2H-triazole-4-carbonitrile.
Molecular Properties
| Compound Name | 5-[3-[3,5-bis(trifluoromethyl)phenyl]-5-chlorophenyl]-2H-triazole-4-carbonitrile |
| PubChem CID | 90468610 |
| Molecular Formula | C17H7ClF6N4 |
| Molecular Weight | 416.71 g/mol |
| Exact Mass | 416.03 |
| IUPAC Name | 5-[3-[3,5-bis(trifluoromethyl)phenyl]-5-chlorophenyl]-2H-triazole-4-carbonitrile |
| SMILES | N#Cc1n[nH]nc1-c1cc(Cl)cc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C17H7ClF6N4/c18-13-4-8(1-10(5-13)15-14(7-25)26-28-27-15)9-2-11(16(19,20)21)6-12(3-9)17(22,23)24/h1-6H,(H,26,27,28) |
| InChIKey | LCLJYLXMZOGCQZ-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.71 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[3-[3,5-bis(trifluoromethyl)phenyl]-5-chlorophenyl]-2H-triazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-[3,5-bis(trifluoromethyl)phenyl]-5-chlorophenyl]-2H-triazole-4-carbonitrile?
The IUPAC name of 5-[3-[3,5-bis(trifluoromethyl)phenyl]-5-chlorophenyl]-2H-triazole-4-carbonitrile (CID 90468610) is 5-[3-[3,5-bis(trifluoromethyl)phenyl]-5-chlorophenyl]-2H-triazole-4-carbonitrile.
What is the SMILES notation for 5-[3-[3,5-bis(trifluoromethyl)phenyl]-5-chlorophenyl]-2H-triazole-4-carbonitrile?
The canonical SMILES for 5-[3-[3,5-bis(trifluoromethyl)phenyl]-5-chlorophenyl]-2H-triazole-4-carbonitrile is N#Cc1n[nH]nc1-c1cc(Cl)cc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1.
What is the InChIKey of 5-[3-[3,5-bis(trifluoromethyl)phenyl]-5-chlorophenyl]-2H-triazole-4-carbonitrile?
The InChIKey is LCLJYLXMZOGCQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H7ClF6N4/c18-13-4-8(1-10(5-13)15-14(7-25)26-28-27-15)9-2-11(16(19,20)21)6-12(3-9)17(22,23)24/h1-6H,(H,26,27,28).
What are the key properties of 5-[3-[3,5-bis(trifluoromethyl)phenyl]-5-chlorophenyl]-2H-triazole-4-carbonitrile?
5-[3-[3,5-bis(trifluoromethyl)phenyl]-5-chlorophenyl]-2H-triazole-4-carbonitrile has a molecular weight of 416.71 g/mol, XLogP of 5.70, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-[3,5-bis(trifluoromethyl)phenyl]-5-chlorophenyl]-2H-triazole-4-carbonitrile is sourced from PubChem (CID 90468610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).