About 5-[3-[[3,4-bis(trifluoromethyl)phenyl]methoxy]phenyl]-2H-triazole-4-carbonitrile
5-[3-[[3,4-bis(trifluoromethyl)phenyl]methoxy]phenyl]-2H-triazole-4-carbonitrile (PubChem CID 90468681) has the molecular formula C18H10F6N4O
and a molecular weight of 412.29 g/mol. Its IUPAC name is 5-[3-[[3,4-bis(trifluoromethyl)phenyl]methoxy]phenyl]-2H-triazole-4-carbonitrile.
Molecular Properties
| Compound Name | 5-[3-[[3,4-bis(trifluoromethyl)phenyl]methoxy]phenyl]-2H-triazole-4-carbonitrile |
| PubChem CID | 90468681 |
| Molecular Formula | C18H10F6N4O |
| Molecular Weight | 412.29 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | 5-[3-[[3,4-bis(trifluoromethyl)phenyl]methoxy]phenyl]-2H-triazole-4-carbonitrile |
| SMILES | N#Cc1n[nH]nc1-c1cccc(OCc2ccc(C(F)(F)F)c(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C18H10F6N4O/c19-17(20,21)13-5-4-10(6-14(13)18(22,23)24)9-29-12-3-1-2-11(7-12)16-15(8-25)26-28-27-16/h1-7H,9H2,(H,26,27,28) |
| InChIKey | YHGMRVYYYAAPEJ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.29 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[3-[[3,4-bis(trifluoromethyl)phenyl]methoxy]phenyl]-2H-triazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-[[3,4-bis(trifluoromethyl)phenyl]methoxy]phenyl]-2H-triazole-4-carbonitrile?
The IUPAC name of 5-[3-[[3,4-bis(trifluoromethyl)phenyl]methoxy]phenyl]-2H-triazole-4-carbonitrile (CID 90468681) is 5-[3-[[3,4-bis(trifluoromethyl)phenyl]methoxy]phenyl]-2H-triazole-4-carbonitrile.
What is the SMILES notation for 5-[3-[[3,4-bis(trifluoromethyl)phenyl]methoxy]phenyl]-2H-triazole-4-carbonitrile?
The canonical SMILES for 5-[3-[[3,4-bis(trifluoromethyl)phenyl]methoxy]phenyl]-2H-triazole-4-carbonitrile is N#Cc1n[nH]nc1-c1cccc(OCc2ccc(C(F)(F)F)c(C(F)(F)F)c2)c1.
What is the InChIKey of 5-[3-[[3,4-bis(trifluoromethyl)phenyl]methoxy]phenyl]-2H-triazole-4-carbonitrile?
The InChIKey is YHGMRVYYYAAPEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H10F6N4O/c19-17(20,21)13-5-4-10(6-14(13)18(22,23)24)9-29-12-3-1-2-11(7-12)16-15(8-25)26-28-27-16/h1-7H,9H2,(H,26,27,28).
What are the key properties of 5-[3-[[3,4-bis(trifluoromethyl)phenyl]methoxy]phenyl]-2H-triazole-4-carbonitrile?
5-[3-[[3,4-bis(trifluoromethyl)phenyl]methoxy]phenyl]-2H-triazole-4-carbonitrile has a molecular weight of 412.29 g/mol, XLogP of 4.96, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-[[3,4-bis(trifluoromethyl)phenyl]methoxy]phenyl]-2H-triazole-4-carbonitrile is sourced from PubChem (CID 90468681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).