C25H34FN5O2 — CID 90468732
[(4aR,8aR)-1,2,3,4a,5,7,8,8a-octahydropyrido[3,4-b][1,4]oxazin-6-yl]-[3-[(1S)-1-[2-[(4-fluoropiperidin-1-yl)methyl]phenyl]ethyl]imidazol-4-yl]methanone (PubChem CID 90468732) has the molecular formula C25H34FN5O2 and a molecular weight of 455.58 g/mol. Its IUPAC name is [(4aR,8aR)-1,2,3,4a,5,7,8,8a-octahydropyrido[3,4-b][1,4]oxazin-6-yl]-[3-[(1S)-1-[2-[(4-fluoropiperidin-1-yl)methyl]phenyl]ethyl]imidazol-4-yl]methanone.
| Compound Name | [(4aR,8aR)-1,2,3,4a,5,7,8,8a-octahydropyrido[3,4-b][1,4]oxazin-6-yl]-[3-[(1S)-1-[2-[(4-fluoropiperidin-1-yl)methyl]phenyl]ethyl]imidazol-4-yl]methanone |
|---|---|
| PubChem CID | 90468732 |
| Molecular Formula | C25H34FN5O2 |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.27 |
| IUPAC Name | [(4aR,8aR)-1,2,3,4a,5,7,8,8a-octahydropyrido[3,4-b][1,4]oxazin-6-yl]-[3-[(1S)-1-[2-[(4-fluoropiperidin-1-yl)methyl]phenyl]ethyl]imidazol-4-yl]methanone |
| SMILES | C[C@@H](c1ccccc1CN1CCC(F)CC1)n1cncc1C(=O)N1CC[C@H]2NCCO[C@@H]2C1 |
| InChI | InChI=1S/C25H34FN5O2/c1-18(21-5-3-2-4-19(21)15-29-10-6-20(26)7-11-29)31-17-27-14-23(31)25(32)30-12-8-22-24(16-30)33-13-9-28-22/h2-5,14,17-18,20,22,24,28H,6-13,15-16H2,1H3/t18-,22+,24+/m0/s1 |
| InChIKey | JHHQKHOHKLRMNG-KUWBRRTOSA-N |
| XLogP | 2.63 |
| TPSA | 62.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |