C26H27FN4O3 — CID 90468798
6-[3-[(1S)-1-[2-(4-fluorophenyl)phenyl]ethyl]imidazole-4-carbonyl]-4a-methyl-5,7,8,8a-tetrahydro-1H-pyrido[3,4-b][1,4]oxazin-2-one (PubChem CID 90468798) has the molecular formula C26H27FN4O3 and a molecular weight of 462.53 g/mol. Its IUPAC name is 6-[3-[(1S)-1-[2-(4-fluorophenyl)phenyl]ethyl]imidazole-4-carbonyl]-4a-methyl-5,7,8,8a-tetrahydro-1H-pyrido[3,4-b][1,4]oxazin-2-one.
| Compound Name | 6-[3-[(1S)-1-[2-(4-fluorophenyl)phenyl]ethyl]imidazole-4-carbonyl]-4a-methyl-5,7,8,8a-tetrahydro-1H-pyrido[3,4-b][1,4]oxazin-2-one |
|---|---|
| PubChem CID | 90468798 |
| Molecular Formula | C26H27FN4O3 |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | 6-[3-[(1S)-1-[2-(4-fluorophenyl)phenyl]ethyl]imidazole-4-carbonyl]-4a-methyl-5,7,8,8a-tetrahydro-1H-pyrido[3,4-b][1,4]oxazin-2-one |
| SMILES | C[C@@H](c1ccccc1-c1ccc(F)cc1)n1cncc1C(=O)N1CCC2NC(=O)COC2(C)C1 |
| InChI | InChI=1S/C26H27FN4O3/c1-17(20-5-3-4-6-21(20)18-7-9-19(27)10-8-18)31-16-28-13-22(31)25(33)30-12-11-23-26(2,15-30)34-14-24(32)29-23/h3-10,13,16-17,23H,11-12,14-15H2,1-2H3,(H,29,32)/t17-,23?,26?/m0/s1 |
| InChIKey | BMGCNIQKFINQMW-LCMVAZINSA-N |
| XLogP | 3.42 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |