About 4-piperazin-1-yl-1-[4-(trifluoromethyl)phenyl]sulfonylpyrrolo[3,2-c]quinoline
4-piperazin-1-yl-1-[4-(trifluoromethyl)phenyl]sulfonylpyrrolo[3,2-c]quinoline (PubChem CID 90469184) has the molecular formula C22H19F3N4O2S
and a molecular weight of 460.48 g/mol. Its IUPAC name is 4-piperazin-1-yl-1-[4-(trifluoromethyl)phenyl]sulfonylpyrrolo[3,2-c]quinoline.
Molecular Properties
| Compound Name | 4-piperazin-1-yl-1-[4-(trifluoromethyl)phenyl]sulfonylpyrrolo[3,2-c]quinoline |
| PubChem CID | 90469184 |
| Molecular Formula | C22H19F3N4O2S |
| Molecular Weight | 460.48 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | 4-piperazin-1-yl-1-[4-(trifluoromethyl)phenyl]sulfonylpyrrolo[3,2-c]quinoline |
| SMILES | O=S(=O)(c1ccc(C(F)(F)F)cc1)n1ccc2c(N3CCNCC3)nc3ccccc3c21 |
| InChI | InChI=1S/C22H19F3N4O2S/c23-22(24,25)15-5-7-16(8-6-15)32(30,31)29-12-9-18-20(29)17-3-1-2-4-19(17)27-21(18)28-13-10-26-11-14-28/h1-9,12,26H,10-11,13-14H2 |
| InChIKey | ZIVNSLSBRMRVPD-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 460.48 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-piperazin-1-yl-1-[4-(trifluoromethyl)phenyl]sulfonylpyrrolo[3,2-c]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-piperazin-1-yl-1-[4-(trifluoromethyl)phenyl]sulfonylpyrrolo[3,2-c]quinoline?
The IUPAC name of 4-piperazin-1-yl-1-[4-(trifluoromethyl)phenyl]sulfonylpyrrolo[3,2-c]quinoline (CID 90469184) is 4-piperazin-1-yl-1-[4-(trifluoromethyl)phenyl]sulfonylpyrrolo[3,2-c]quinoline.
What is the SMILES notation for 4-piperazin-1-yl-1-[4-(trifluoromethyl)phenyl]sulfonylpyrrolo[3,2-c]quinoline?
The canonical SMILES for 4-piperazin-1-yl-1-[4-(trifluoromethyl)phenyl]sulfonylpyrrolo[3,2-c]quinoline is O=S(=O)(c1ccc(C(F)(F)F)cc1)n1ccc2c(N3CCNCC3)nc3ccccc3c21.
What is the InChIKey of 4-piperazin-1-yl-1-[4-(trifluoromethyl)phenyl]sulfonylpyrrolo[3,2-c]quinoline?
The InChIKey is ZIVNSLSBRMRVPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19F3N4O2S/c23-22(24,25)15-5-7-16(8-6-15)32(30,31)29-12-9-18-20(29)17-3-1-2-4-19(17)27-21(18)28-13-10-26-11-14-28/h1-9,12,26H,10-11,13-14H2.
What are the key properties of 4-piperazin-1-yl-1-[4-(trifluoromethyl)phenyl]sulfonylpyrrolo[3,2-c]quinoline?
4-piperazin-1-yl-1-[4-(trifluoromethyl)phenyl]sulfonylpyrrolo[3,2-c]quinoline has a molecular weight of 460.48 g/mol, XLogP of 3.85, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-piperazin-1-yl-1-[4-(trifluoromethyl)phenyl]sulfonylpyrrolo[3,2-c]quinoline is sourced from PubChem (CID 90469184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).