C25H27N5O4 — CID 90469421
N-[3-[5-methoxy-2-[[2-(2-methoxyethyl)-1,3-dihydroisoindol-5-yl]amino]pyrimidin-4-yl]oxyphenyl]prop-2-enamide (PubChem CID 90469421) has the molecular formula C25H27N5O4 and a molecular weight of 461.52 g/mol. Its IUPAC name is N-[3-[5-methoxy-2-[[2-(2-methoxyethyl)-1,3-dihydroisoindol-5-yl]amino]pyrimidin-4-yl]oxyphenyl]prop-2-enamide.
| Compound Name | N-[3-[5-methoxy-2-[[2-(2-methoxyethyl)-1,3-dihydroisoindol-5-yl]amino]pyrimidin-4-yl]oxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 90469421 |
| Molecular Formula | C25H27N5O4 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | N-[3-[5-methoxy-2-[[2-(2-methoxyethyl)-1,3-dihydroisoindol-5-yl]amino]pyrimidin-4-yl]oxyphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(Oc2nc(Nc3ccc4c(c3)CN(CCOC)C4)ncc2OC)c1 |
| InChI | InChI=1S/C25H27N5O4/c1-4-23(31)27-19-6-5-7-21(13-19)34-24-22(33-3)14-26-25(29-24)28-20-9-8-17-15-30(10-11-32-2)16-18(17)12-20/h4-9,12-14H,1,10-11,15-16H2,2-3H3,(H,27,31)(H,26,28,29) |
| InChIKey | DHGHARMJWIJNAW-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 97.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|