C12H10N6O — CID 90469568
2-N-(1,2-oxazol-4-yl)-6-phenyl-1,3,5-triazine-2,4-diamine (PubChem CID 90469568) has the molecular formula C12H10N6O and a molecular weight of 254.25 g/mol. Its IUPAC name is 2-N-(1,2-oxazol-4-yl)-6-phenyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(1,2-oxazol-4-yl)-6-phenyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 90469568 |
| Molecular Formula | C12H10N6O |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 2-N-(1,2-oxazol-4-yl)-6-phenyl-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(Nc2cnoc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C12H10N6O/c13-11-16-10(8-4-2-1-3-5-8)17-12(18-11)15-9-6-14-19-7-9/h1-7H,(H3,13,15,16,17,18) |
| InChIKey | PZYSVORAFQZKPQ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 102.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |