About 5-[(Z)-3-(2-hydroxyphenyl)prop-2-enyl]-2,3,4-trimethoxyphenol
5-[(Z)-3-(2-hydroxyphenyl)prop-2-enyl]-2,3,4-trimethoxyphenol (PubChem CID 90470263) has the molecular formula C18H20O5
and a molecular weight of 316.35 g/mol. Its IUPAC name is 5-[(Z)-3-(2-hydroxyphenyl)prop-2-enyl]-2,3,4-trimethoxyphenol.
Molecular Properties
| Compound Name | 5-[(Z)-3-(2-hydroxyphenyl)prop-2-enyl]-2,3,4-trimethoxyphenol |
| PubChem CID | 90470263 |
| Molecular Formula | C18H20O5 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 5-[(Z)-3-(2-hydroxyphenyl)prop-2-enyl]-2,3,4-trimethoxyphenol |
| SMILES | COc1c(O)cc(C/C=C\c2ccccc2O)c(OC)c1OC |
| InChI | InChI=1S/C18H20O5/c1-21-16-13(11-15(20)17(22-2)18(16)23-3)9-6-8-12-7-4-5-10-14(12)19/h4-8,10-11,19-20H,9H2,1-3H3/b8-6- |
| InChIKey | VYLCBHNYHRQVPC-VURMDHGXSA-N |
| XLogP | 3.38 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[(Z)-3-(2-hydroxyphenyl)prop-2-enyl]-2,3,4-trimethoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(Z)-3-(2-hydroxyphenyl)prop-2-enyl]-2,3,4-trimethoxyphenol?
The IUPAC name of 5-[(Z)-3-(2-hydroxyphenyl)prop-2-enyl]-2,3,4-trimethoxyphenol (CID 90470263) is 5-[(Z)-3-(2-hydroxyphenyl)prop-2-enyl]-2,3,4-trimethoxyphenol.
What is the SMILES notation for 5-[(Z)-3-(2-hydroxyphenyl)prop-2-enyl]-2,3,4-trimethoxyphenol?
The canonical SMILES for 5-[(Z)-3-(2-hydroxyphenyl)prop-2-enyl]-2,3,4-trimethoxyphenol is COc1c(O)cc(C/C=C\c2ccccc2O)c(OC)c1OC.
What is the InChIKey of 5-[(Z)-3-(2-hydroxyphenyl)prop-2-enyl]-2,3,4-trimethoxyphenol?
The InChIKey is VYLCBHNYHRQVPC-VURMDHGXSA-N. The full InChI is InChI=1S/C18H20O5/c1-21-16-13(11-15(20)17(22-2)18(16)23-3)9-6-8-12-7-4-5-10-14(12)19/h4-8,10-11,19-20H,9H2,1-3H3/b8-6-.
What are the key properties of 5-[(Z)-3-(2-hydroxyphenyl)prop-2-enyl]-2,3,4-trimethoxyphenol?
5-[(Z)-3-(2-hydroxyphenyl)prop-2-enyl]-2,3,4-trimethoxyphenol has a molecular weight of 316.35 g/mol, XLogP of 3.38, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(Z)-3-(2-hydroxyphenyl)prop-2-enyl]-2,3,4-trimethoxyphenol is sourced from PubChem (CID 90470263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).