About CID 90470639
CID 90470639 (PubChem CID 90470639) has the molecular formula C8H14Ge
and a molecular weight of 182.81 g/mol.
Molecular Properties
| Compound Name | CID 90470639 |
| PubChem CID | 90470639 |
| Molecular Formula | C8H14Ge |
| Molecular Weight | 182.81 g/mol |
| Exact Mass | 184.03 |
| IUPAC Name | — |
| SMILES | C[Ge](C)C.[CH]1[CH][CH][CH][CH]1 |
| InChI | InChI=1S/C5H5.C3H9Ge/c1-2-4-5-3-1;1-4(2)3/h1-5H;1-3H3 |
| InChIKey | GRJKIDAJURZVOC-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.81 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 90470639 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 90470639?
The IUPAC name of CID 90470639 (CID 90470639) is not available.
What is the SMILES notation for CID 90470639?
The canonical SMILES for CID 90470639 is C[Ge](C)C.[CH]1[CH][CH][CH][CH]1.
What is the InChIKey of CID 90470639?
The InChIKey is GRJKIDAJURZVOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5.C3H9Ge/c1-2-4-5-3-1;1-4(2)3/h1-5H;1-3H3.
What are the key properties of CID 90470639?
CID 90470639 has a molecular weight of 182.81 g/mol, XLogP of 2.39, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 90470639 is sourced from PubChem (CID 90470639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).