About 3-[2-ethylsulfanylethylsulfanyl(methyl)phosphoryl]oxy-2,2-dimethylbutane
3-[2-ethylsulfanylethylsulfanyl(methyl)phosphoryl]oxy-2,2-dimethylbutane (PubChem CID 90470717) has the molecular formula C11H25O2PS2
and a molecular weight of 284.43 g/mol. Its IUPAC name is 3-[2-ethylsulfanylethylsulfanyl(methyl)phosphoryl]oxy-2,2-dimethylbutane.
Molecular Properties
| Compound Name | 3-[2-ethylsulfanylethylsulfanyl(methyl)phosphoryl]oxy-2,2-dimethylbutane |
| PubChem CID | 90470717 |
| Molecular Formula | C11H25O2PS2 |
| Molecular Weight | 284.43 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 3-[2-ethylsulfanylethylsulfanyl(methyl)phosphoryl]oxy-2,2-dimethylbutane |
| SMILES | CCSCCSP(C)(=O)OC(C)C(C)(C)C |
| InChI | InChI=1S/C11H25O2PS2/c1-7-15-8-9-16-14(6,12)13-10(2)11(3,4)5/h10H,7-9H2,1-6H3 |
| InChIKey | VZLDNTBNDXLBKB-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.43 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-ethylsulfanylethylsulfanyl(methyl)phosphoryl]oxy-2,2-dimethylbutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-ethylsulfanylethylsulfanyl(methyl)phosphoryl]oxy-2,2-dimethylbutane?
The IUPAC name of 3-[2-ethylsulfanylethylsulfanyl(methyl)phosphoryl]oxy-2,2-dimethylbutane (CID 90470717) is 3-[2-ethylsulfanylethylsulfanyl(methyl)phosphoryl]oxy-2,2-dimethylbutane.
What is the SMILES notation for 3-[2-ethylsulfanylethylsulfanyl(methyl)phosphoryl]oxy-2,2-dimethylbutane?
The canonical SMILES for 3-[2-ethylsulfanylethylsulfanyl(methyl)phosphoryl]oxy-2,2-dimethylbutane is CCSCCSP(C)(=O)OC(C)C(C)(C)C.
What is the InChIKey of 3-[2-ethylsulfanylethylsulfanyl(methyl)phosphoryl]oxy-2,2-dimethylbutane?
The InChIKey is VZLDNTBNDXLBKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H25O2PS2/c1-7-15-8-9-16-14(6,12)13-10(2)11(3,4)5/h10H,7-9H2,1-6H3.
What are the key properties of 3-[2-ethylsulfanylethylsulfanyl(methyl)phosphoryl]oxy-2,2-dimethylbutane?
3-[2-ethylsulfanylethylsulfanyl(methyl)phosphoryl]oxy-2,2-dimethylbutane has a molecular weight of 284.43 g/mol, XLogP of 4.75, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-ethylsulfanylethylsulfanyl(methyl)phosphoryl]oxy-2,2-dimethylbutane is sourced from PubChem (CID 90470717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).