About 2-sulfanylethylazanium;2,3,4-trihydroxy-4-oxobutanoate
2-sulfanylethylazanium;2,3,4-trihydroxy-4-oxobutanoate (PubChem CID 90470742) has the molecular formula C6H13NO6S
and a molecular weight of 227.24 g/mol. Its IUPAC name is 2-sulfanylethylazanium;2,3,4-trihydroxy-4-oxobutanoate.
Molecular Properties
| Compound Name | 2-sulfanylethylazanium;2,3,4-trihydroxy-4-oxobutanoate |
| PubChem CID | 90470742 |
| Molecular Formula | C6H13NO6S |
| Molecular Weight | 227.24 g/mol |
| Exact Mass | 227.05 |
| IUPAC Name | 2-sulfanylethylazanium;2,3,4-trihydroxy-4-oxobutanoate |
| SMILES | O=C([O-])C(O)C(O)C(=O)O.[NH3+]CCS |
| InChI | InChI=1S/C4H6O6.C2H7NS/c5-1(3(7)8)2(6)4(9)10;3-1-2-4/h1-2,5-6H,(H,7,8)(H,9,10);4H,1-3H2 |
| InChIKey | NSKJTUFFDRENDM-UHFFFAOYSA-N |
| XLogP | -4.30 |
| TPSA | 145.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.24 |
| LogP ≤ 5 | -4.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-sulfanylethylazanium;2,3,4-trihydroxy-4-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-sulfanylethylazanium;2,3,4-trihydroxy-4-oxobutanoate?
The IUPAC name of 2-sulfanylethylazanium;2,3,4-trihydroxy-4-oxobutanoate (CID 90470742) is 2-sulfanylethylazanium;2,3,4-trihydroxy-4-oxobutanoate.
What is the SMILES notation for 2-sulfanylethylazanium;2,3,4-trihydroxy-4-oxobutanoate?
The canonical SMILES for 2-sulfanylethylazanium;2,3,4-trihydroxy-4-oxobutanoate is O=C([O-])C(O)C(O)C(=O)O.[NH3+]CCS.
What is the InChIKey of 2-sulfanylethylazanium;2,3,4-trihydroxy-4-oxobutanoate?
The InChIKey is NSKJTUFFDRENDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O6.C2H7NS/c5-1(3(7)8)2(6)4(9)10;3-1-2-4/h1-2,5-6H,(H,7,8)(H,9,10);4H,1-3H2.
What are the key properties of 2-sulfanylethylazanium;2,3,4-trihydroxy-4-oxobutanoate?
2-sulfanylethylazanium;2,3,4-trihydroxy-4-oxobutanoate has a molecular weight of 227.24 g/mol, XLogP of -4.30, 4 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-sulfanylethylazanium;2,3,4-trihydroxy-4-oxobutanoate is sourced from PubChem (CID 90470742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).