C14H19BrClN2O9P — CID 90471036
azane;(5-bromo-4-chloro-1H-indol-3-yl) [(2R,3S,5R,6R)-2,3,4,5,6-pentahydroxycyclohexyl] hydrogen phosphate (PubChem CID 90471036) has the molecular formula C14H19BrClN2O9P and a molecular weight of 505.64 g/mol. Its IUPAC name is azane;(5-bromo-4-chloro-1H-indol-3-yl) [(2R,3S,5R,6R)-2,3,4,5,6-pentahydroxycyclohexyl] hydrogen phosphate.
| Compound Name | azane;(5-bromo-4-chloro-1H-indol-3-yl) [(2R,3S,5R,6R)-2,3,4,5,6-pentahydroxycyclohexyl] hydrogen phosphate |
|---|---|
| PubChem CID | 90471036 |
| Molecular Formula | C14H19BrClN2O9P |
| Molecular Weight | 505.64 g/mol |
| Exact Mass | 503.97 |
| IUPAC Name | azane;(5-bromo-4-chloro-1H-indol-3-yl) [(2R,3S,5R,6R)-2,3,4,5,6-pentahydroxycyclohexyl] hydrogen phosphate |
| SMILES | N.O=P(O)(Oc1c[nH]c2ccc(Br)c(Cl)c12)OC1[C@H](O)[C@H](O)C(O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C14H16BrClNO9P.H3N/c15-4-1-2-5-7(8(4)16)6(3-17-5)25-27(23,24)26-14-12(21)10(19)9(18)11(20)13(14)22;/h1-3,9-14,17-22H,(H,23,24);1H3/t9?,10-,11+,12-,13-,14?;/m1./s1 |
| InChIKey | HIFQQHVVHCJEPZ-STHBLVJOSA-N |
| XLogP | 0.43 |
| TPSA | 207.70 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.64 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|