C12H15N3O6 — CID 90471145
2,4,6-tris[[(2S)-oxiran-2-yl]methoxy]-1,3,5-triazine (PubChem CID 90471145) has the molecular formula C12H15N3O6 and a molecular weight of 297.27 g/mol. Its IUPAC name is 2,4,6-tris[[(2S)-oxiran-2-yl]methoxy]-1,3,5-triazine.
| Compound Name | 2,4,6-tris[[(2S)-oxiran-2-yl]methoxy]-1,3,5-triazine |
|---|---|
| PubChem CID | 90471145 |
| Molecular Formula | C12H15N3O6 |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 2,4,6-tris[[(2S)-oxiran-2-yl]methoxy]-1,3,5-triazine |
| SMILES | C(Oc1nc(OC[C@@H]2CO2)nc(OC[C@@H]2CO2)n1)[C@@H]1CO1 |
| InChI | InChI=1S/C12H15N3O6/c1-7(16-1)4-19-10-13-11(20-5-8-2-17-8)15-12(14-10)21-6-9-3-18-9/h7-9H,1-6H2/t7-,8-,9-/m0/s1 |
| InChIKey | BLPURQSRCDKZNX-CIUDSAMLSA-N |
| XLogP | -0.80 |
| TPSA | 103.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|