About CID 90471180
CID 90471180 (PubChem CID 90471180) has the molecular formula C9H8N
and a molecular weight of 130.17 g/mol.
Molecular Properties
| Compound Name | CID 90471180 |
| PubChem CID | 90471180 |
| Molecular Formula | C9H8N |
| Molecular Weight | 130.17 g/mol |
| Exact Mass | 130.07 |
| IUPAC Name | — |
| SMILES | Cc1cccc2c1=C[CH]N=2 |
| InChI | InChI=1S/C9H8N/c1-7-3-2-4-9-8(7)5-6-10-9/h2-6H,1H3 |
| InChIKey | GETGTCHPAMDDHG-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.17 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 90471180 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 90471180?
The IUPAC name of CID 90471180 (CID 90471180) is not available.
What is the SMILES notation for CID 90471180?
The canonical SMILES for CID 90471180 is Cc1cccc2c1=C[CH]N=2.
What is the InChIKey of CID 90471180?
The InChIKey is GETGTCHPAMDDHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N/c1-7-3-2-4-9-8(7)5-6-10-9/h2-6H,1H3.
What are the key properties of CID 90471180?
CID 90471180 has a molecular weight of 130.17 g/mol, XLogP of 0.57, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 90471180 is sourced from PubChem (CID 90471180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).