About (2R,3S)-1-benzyl-2-methyl-2,3-bis(phenylmethoxy)pyrrolidine
(2R,3S)-1-benzyl-2-methyl-2,3-bis(phenylmethoxy)pyrrolidine (PubChem CID 90471286) has the molecular formula C26H29NO2
and a molecular weight of 387.52 g/mol. Its IUPAC name is (2R,3S)-1-benzyl-2-methyl-2,3-bis(phenylmethoxy)pyrrolidine.
Molecular Properties
| Compound Name | (2R,3S)-1-benzyl-2-methyl-2,3-bis(phenylmethoxy)pyrrolidine |
| PubChem CID | 90471286 |
| Molecular Formula | C26H29NO2 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | (2R,3S)-1-benzyl-2-methyl-2,3-bis(phenylmethoxy)pyrrolidine |
| SMILES | C[C@@]1(OCc2ccccc2)[C@@H](OCc2ccccc2)CCN1Cc1ccccc1 |
| InChI | InChI=1S/C26H29NO2/c1-26(29-21-24-15-9-4-10-16-24)25(28-20-23-13-7-3-8-14-23)17-18-27(26)19-22-11-5-2-6-12-22/h2-16,25H,17-21H2,1H3/t25-,26+/m0/s1 |
| InChIKey | MQPBJPFBBXFAPH-IZZNHLLZSA-N |
| XLogP | 5.41 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R,3S)-1-benzyl-2-methyl-2,3-bis(phenylmethoxy)pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3S)-1-benzyl-2-methyl-2,3-bis(phenylmethoxy)pyrrolidine?
The IUPAC name of (2R,3S)-1-benzyl-2-methyl-2,3-bis(phenylmethoxy)pyrrolidine (CID 90471286) is (2R,3S)-1-benzyl-2-methyl-2,3-bis(phenylmethoxy)pyrrolidine.
What is the SMILES notation for (2R,3S)-1-benzyl-2-methyl-2,3-bis(phenylmethoxy)pyrrolidine?
The canonical SMILES for (2R,3S)-1-benzyl-2-methyl-2,3-bis(phenylmethoxy)pyrrolidine is C[C@@]1(OCc2ccccc2)[C@@H](OCc2ccccc2)CCN1Cc1ccccc1.
What is the InChIKey of (2R,3S)-1-benzyl-2-methyl-2,3-bis(phenylmethoxy)pyrrolidine?
The InChIKey is MQPBJPFBBXFAPH-IZZNHLLZSA-N. The full InChI is InChI=1S/C26H29NO2/c1-26(29-21-24-15-9-4-10-16-24)25(28-20-23-13-7-3-8-14-23)17-18-27(26)19-22-11-5-2-6-12-22/h2-16,25H,17-21H2,1H3/t25-,26+/m0/s1.
What are the key properties of (2R,3S)-1-benzyl-2-methyl-2,3-bis(phenylmethoxy)pyrrolidine?
(2R,3S)-1-benzyl-2-methyl-2,3-bis(phenylmethoxy)pyrrolidine has a molecular weight of 387.52 g/mol, XLogP of 5.41, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3S)-1-benzyl-2-methyl-2,3-bis(phenylmethoxy)pyrrolidine is sourced from PubChem (CID 90471286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).