About 4-[(3E)-3-ethylidene-5,5-dimethylcyclohexen-1-yl]morpholine
4-[(3E)-3-ethylidene-5,5-dimethylcyclohexen-1-yl]morpholine (PubChem CID 90471503) has the molecular formula C14H23NO
and a molecular weight of 221.34 g/mol. Its IUPAC name is 4-[(3E)-3-ethylidene-5,5-dimethylcyclohexen-1-yl]morpholine.
Molecular Properties
| Compound Name | 4-[(3E)-3-ethylidene-5,5-dimethylcyclohexen-1-yl]morpholine |
| PubChem CID | 90471503 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 4-[(3E)-3-ethylidene-5,5-dimethylcyclohexen-1-yl]morpholine |
| SMILES | C/C=C1/C=C(N2CCOCC2)CC(C)(C)C1 |
| InChI | InChI=1S/C14H23NO/c1-4-12-9-13(11-14(2,3)10-12)15-5-7-16-8-6-15/h4,9H,5-8,10-11H2,1-3H3/b12-4- |
| InChIKey | UTOQXBAMXGKPKA-QCDXTXTGSA-N |
| XLogP | 2.97 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[(3E)-3-ethylidene-5,5-dimethylcyclohexen-1-yl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3E)-3-ethylidene-5,5-dimethylcyclohexen-1-yl]morpholine?
The IUPAC name of 4-[(3E)-3-ethylidene-5,5-dimethylcyclohexen-1-yl]morpholine (CID 90471503) is 4-[(3E)-3-ethylidene-5,5-dimethylcyclohexen-1-yl]morpholine.
What is the SMILES notation for 4-[(3E)-3-ethylidene-5,5-dimethylcyclohexen-1-yl]morpholine?
The canonical SMILES for 4-[(3E)-3-ethylidene-5,5-dimethylcyclohexen-1-yl]morpholine is C/C=C1/C=C(N2CCOCC2)CC(C)(C)C1.
What is the InChIKey of 4-[(3E)-3-ethylidene-5,5-dimethylcyclohexen-1-yl]morpholine?
The InChIKey is UTOQXBAMXGKPKA-QCDXTXTGSA-N. The full InChI is InChI=1S/C14H23NO/c1-4-12-9-13(11-14(2,3)10-12)15-5-7-16-8-6-15/h4,9H,5-8,10-11H2,1-3H3/b12-4-.
What are the key properties of 4-[(3E)-3-ethylidene-5,5-dimethylcyclohexen-1-yl]morpholine?
4-[(3E)-3-ethylidene-5,5-dimethylcyclohexen-1-yl]morpholine has a molecular weight of 221.34 g/mol, XLogP of 2.97, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3E)-3-ethylidene-5,5-dimethylcyclohexen-1-yl]morpholine is sourced from PubChem (CID 90471503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).