C21H25NO8 — CID 90472062
[(1S,6S,7R,8R,8aR)-1,7,8-triacetyloxy-1,2,3,5,6,7,8,8a-octahydroindolizin-6-yl] benzoate (PubChem CID 90472062) has the molecular formula C21H25NO8 and a molecular weight of 419.43 g/mol. Its IUPAC name is [(1S,6S,7R,8R,8aR)-1,7,8-triacetyloxy-1,2,3,5,6,7,8,8a-octahydroindolizin-6-yl] benzoate.
| Compound Name | [(1S,6S,7R,8R,8aR)-1,7,8-triacetyloxy-1,2,3,5,6,7,8,8a-octahydroindolizin-6-yl] benzoate |
|---|---|
| PubChem CID | 90472062 |
| Molecular Formula | C21H25NO8 |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | [(1S,6S,7R,8R,8aR)-1,7,8-triacetyloxy-1,2,3,5,6,7,8,8a-octahydroindolizin-6-yl] benzoate |
| SMILES | CC(=O)O[C@H]1[C@H](OC(C)=O)[C@@H](OC(=O)c2ccccc2)CN2CC[C@H](OC(C)=O)[C@H]12 |
| InChI | InChI=1S/C21H25NO8/c1-12(23)27-16-9-10-22-11-17(30-21(26)15-7-5-4-6-8-15)19(28-13(2)24)20(18(16)22)29-14(3)25/h4-8,16-20H,9-11H2,1-3H3/t16-,17-,18+,19+,20+/m0/s1 |
| InChIKey | QQHMCFAWHFYUFE-CENDIDJXSA-N |
| XLogP | 1.10 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|