C30H12O9 — CID 90473021
1,7,13-trihydroxytrinaphthylene-5,6,11,12,17,18-hexone (PubChem CID 90473021) has the molecular formula C30H12O9 and a molecular weight of 516.42 g/mol. Its IUPAC name is 1,7,13-trihydroxytrinaphthylene-5,6,11,12,17,18-hexone.
| Compound Name | 1,7,13-trihydroxytrinaphthylene-5,6,11,12,17,18-hexone |
|---|---|
| PubChem CID | 90473021 |
| Molecular Formula | C30H12O9 |
| Molecular Weight | 516.42 g/mol |
| Exact Mass | 516.05 |
| IUPAC Name | 1,7,13-trihydroxytrinaphthylene-5,6,11,12,17,18-hexone |
| SMILES | O=c1c2cccc(O)c2c(=O)c2c1c1c(=O)c3c(O)cccc3c(=O)c1c1c(=O)c3c(O)cccc3c(=O)c21 |
| InChI | InChI=1S/C30H12O9/c31-13-7-1-4-10-16(13)28(37)22-19(25(10)34)23-21(27(36)11-5-2-8-14(32)17(11)29(23)38)24-20(22)26(35)12-6-3-9-15(33)18(12)30(24)39/h1-9,31-33H |
| InChIKey | DNGCQXLPUZWYNB-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 163.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.42 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|