About 3-methylbutan-2-yl 1-[(4-tert-butylphenyl)methylsulfanyl]-N-pyridin-3-ylmethanimidate
3-methylbutan-2-yl 1-[(4-tert-butylphenyl)methylsulfanyl]-N-pyridin-3-ylmethanimidate (PubChem CID 90473061) has the molecular formula C22H30N2OS
and a molecular weight of 370.56 g/mol. Its IUPAC name is 3-methylbutan-2-yl 1-[(4-tert-butylphenyl)methylsulfanyl]-N-pyridin-3-ylmethanimidate.
Molecular Properties
| Compound Name | 3-methylbutan-2-yl 1-[(4-tert-butylphenyl)methylsulfanyl]-N-pyridin-3-ylmethanimidate |
| PubChem CID | 90473061 |
| Molecular Formula | C22H30N2OS |
| Molecular Weight | 370.56 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | 3-methylbutan-2-yl 1-[(4-tert-butylphenyl)methylsulfanyl]-N-pyridin-3-ylmethanimidate |
| SMILES | CC(C)C(C)O/C(=N\c1cccnc1)SCc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C22H30N2OS/c1-16(2)17(3)25-21(24-20-8-7-13-23-14-20)26-15-18-9-11-19(12-10-18)22(4,5)6/h7-14,16-17H,15H2,1-6H3/b24-21+ |
| InChIKey | UNSBGTGBLZJZFJ-DARPEHSRSA-N |
| XLogP | 6.36 |
| TPSA | 34.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.56 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-methylbutan-2-yl 1-[(4-tert-butylphenyl)methylsulfanyl]-N-pyridin-3-ylmethanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbutan-2-yl 1-[(4-tert-butylphenyl)methylsulfanyl]-N-pyridin-3-ylmethanimidate?
The IUPAC name of 3-methylbutan-2-yl 1-[(4-tert-butylphenyl)methylsulfanyl]-N-pyridin-3-ylmethanimidate (CID 90473061) is 3-methylbutan-2-yl 1-[(4-tert-butylphenyl)methylsulfanyl]-N-pyridin-3-ylmethanimidate.
What is the SMILES notation for 3-methylbutan-2-yl 1-[(4-tert-butylphenyl)methylsulfanyl]-N-pyridin-3-ylmethanimidate?
The canonical SMILES for 3-methylbutan-2-yl 1-[(4-tert-butylphenyl)methylsulfanyl]-N-pyridin-3-ylmethanimidate is CC(C)C(C)O/C(=N\c1cccnc1)SCc1ccc(C(C)(C)C)cc1.
What is the InChIKey of 3-methylbutan-2-yl 1-[(4-tert-butylphenyl)methylsulfanyl]-N-pyridin-3-ylmethanimidate?
The InChIKey is UNSBGTGBLZJZFJ-DARPEHSRSA-N. The full InChI is InChI=1S/C22H30N2OS/c1-16(2)17(3)25-21(24-20-8-7-13-23-14-20)26-15-18-9-11-19(12-10-18)22(4,5)6/h7-14,16-17H,15H2,1-6H3/b24-21+.
What are the key properties of 3-methylbutan-2-yl 1-[(4-tert-butylphenyl)methylsulfanyl]-N-pyridin-3-ylmethanimidate?
3-methylbutan-2-yl 1-[(4-tert-butylphenyl)methylsulfanyl]-N-pyridin-3-ylmethanimidate has a molecular weight of 370.56 g/mol, XLogP of 6.36, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbutan-2-yl 1-[(4-tert-butylphenyl)methylsulfanyl]-N-pyridin-3-ylmethanimidate is sourced from PubChem (CID 90473061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).