C10H15NO4 — CID 90473111
(NE)-N-[(2,4,6-trimethoxycyclohexa-1,5-dien-1-yl)methylidene]hydroxylamine (PubChem CID 90473111) has the molecular formula C10H15NO4 and a molecular weight of 213.23 g/mol. Its IUPAC name is (NE)-N-[(2,4,6-trimethoxycyclohexa-1,5-dien-1-yl)methylidene]hydroxylamine.
| Compound Name | (NE)-N-[(2,4,6-trimethoxycyclohexa-1,5-dien-1-yl)methylidene]hydroxylamine |
|---|---|
| PubChem CID | 90473111 |
| Molecular Formula | C10H15NO4 |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | (NE)-N-[(2,4,6-trimethoxycyclohexa-1,5-dien-1-yl)methylidene]hydroxylamine |
| SMILES | COC1=CC(OC)CC(OC)=C1/C=N/O |
| InChI | InChI=1S/C10H15NO4/c1-13-7-4-9(14-2)8(6-11-12)10(5-7)15-3/h4,6-7,12H,5H2,1-3H3/b11-6+ |
| InChIKey | XYIZUMSWWIAKNC-IZZDOVSWSA-N |
| XLogP | 1.30 |
| TPSA | 60.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|