About sodium;4-hydroxy-2-nitrosobenzaldehyde;bis(4-hydroxy-3-nitrosobenzaldehyde);iron
sodium;4-hydroxy-2-nitrosobenzaldehyde;bis(4-hydroxy-3-nitrosobenzaldehyde);iron (PubChem CID 90473210) has the molecular formula C21H15FeN3NaO9+
and a molecular weight of 532.20 g/mol. Its IUPAC name is sodium;4-hydroxy-2-nitrosobenzaldehyde;bis(4-hydroxy-3-nitrosobenzaldehyde);iron.
Molecular Properties
| Compound Name | sodium;4-hydroxy-2-nitrosobenzaldehyde;bis(4-hydroxy-3-nitrosobenzaldehyde);iron |
| PubChem CID | 90473210 |
| Molecular Formula | C21H15FeN3NaO9+ |
| Molecular Weight | 532.20 g/mol |
| Exact Mass | 532.00 |
| IUPAC Name | sodium;4-hydroxy-2-nitrosobenzaldehyde;bis(4-hydroxy-3-nitrosobenzaldehyde);iron |
| SMILES | O=Cc1ccc(O)c(N=O)c1.O=Cc1ccc(O)c(N=O)c1.O=Cc1ccc(O)cc1N=O.[Fe].[Na+] |
| InChI | InChI=1S/3C7H5NO3.Fe.Na/c9-4-5-1-2-6(10)3-7(5)8-11;2*9-4-5-1-2-7(10)6(3-5)8-11;;/h3*1-4,10H;;/q;;;;+1 |
| InChIKey | SDLAWGQZIZEQAD-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 200.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 532.20 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze sodium;4-hydroxy-2-nitrosobenzaldehyde;bis(4-hydroxy-3-nitrosobenzaldehyde);iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;4-hydroxy-2-nitrosobenzaldehyde;bis(4-hydroxy-3-nitrosobenzaldehyde);iron?
The IUPAC name of sodium;4-hydroxy-2-nitrosobenzaldehyde;bis(4-hydroxy-3-nitrosobenzaldehyde);iron (CID 90473210) is sodium;4-hydroxy-2-nitrosobenzaldehyde;bis(4-hydroxy-3-nitrosobenzaldehyde);iron.
What is the SMILES notation for sodium;4-hydroxy-2-nitrosobenzaldehyde;bis(4-hydroxy-3-nitrosobenzaldehyde);iron?
The canonical SMILES for sodium;4-hydroxy-2-nitrosobenzaldehyde;bis(4-hydroxy-3-nitrosobenzaldehyde);iron is O=Cc1ccc(O)c(N=O)c1.O=Cc1ccc(O)c(N=O)c1.O=Cc1ccc(O)cc1N=O.[Fe].[Na+].
What is the InChIKey of sodium;4-hydroxy-2-nitrosobenzaldehyde;bis(4-hydroxy-3-nitrosobenzaldehyde);iron?
The InChIKey is SDLAWGQZIZEQAD-UHFFFAOYSA-N. The full InChI is InChI=1S/3C7H5NO3.Fe.Na/c9-4-5-1-2-6(10)3-7(5)8-11;2*9-4-5-1-2-7(10)6(3-5)8-11;;/h3*1-4,10H;;/q;;;;+1.
What are the key properties of sodium;4-hydroxy-2-nitrosobenzaldehyde;bis(4-hydroxy-3-nitrosobenzaldehyde);iron?
sodium;4-hydroxy-2-nitrosobenzaldehyde;bis(4-hydroxy-3-nitrosobenzaldehyde);iron has a molecular weight of 532.20 g/mol, XLogP of 1.81, 6 rotatable bonds, 3 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;4-hydroxy-2-nitrosobenzaldehyde;bis(4-hydroxy-3-nitrosobenzaldehyde);iron is sourced from PubChem (CID 90473210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).