About 5-[(1E,3E)-hexa-1,3-dienyl]-3-(2-hydroxybutanoyl)-4-methoxy-5-methylfuran-2-one
5-[(1E,3E)-hexa-1,3-dienyl]-3-(2-hydroxybutanoyl)-4-methoxy-5-methylfuran-2-one (PubChem CID 90473370) has the molecular formula C16H22O5
and a molecular weight of 294.35 g/mol. Its IUPAC name is 5-[(1E,3E)-hexa-1,3-dienyl]-3-(2-hydroxybutanoyl)-4-methoxy-5-methylfuran-2-one.
Molecular Properties
| Compound Name | 5-[(1E,3E)-hexa-1,3-dienyl]-3-(2-hydroxybutanoyl)-4-methoxy-5-methylfuran-2-one |
| PubChem CID | 90473370 |
| Molecular Formula | C16H22O5 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 5-[(1E,3E)-hexa-1,3-dienyl]-3-(2-hydroxybutanoyl)-4-methoxy-5-methylfuran-2-one |
| SMILES | CC/C=C/C=C/C1(C)OC(=O)C(C(=O)C(O)CC)=C1OC |
| InChI | InChI=1S/C16H22O5/c1-5-7-8-9-10-16(3)14(20-4)12(15(19)21-16)13(18)11(17)6-2/h7-11,17H,5-6H2,1-4H3/b8-7+,10-9+ |
| InChIKey | WTWOEAFZDICZQF-XBLVEGMJSA-N |
| XLogP | 2.06 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 5-[(1E,3E)-hexa-1,3-dienyl]-3-(2-hydroxybutanoyl)-4-methoxy-5-methylfuran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(1E,3E)-hexa-1,3-dienyl]-3-(2-hydroxybutanoyl)-4-methoxy-5-methylfuran-2-one?
The IUPAC name of 5-[(1E,3E)-hexa-1,3-dienyl]-3-(2-hydroxybutanoyl)-4-methoxy-5-methylfuran-2-one (CID 90473370) is 5-[(1E,3E)-hexa-1,3-dienyl]-3-(2-hydroxybutanoyl)-4-methoxy-5-methylfuran-2-one.
What is the SMILES notation for 5-[(1E,3E)-hexa-1,3-dienyl]-3-(2-hydroxybutanoyl)-4-methoxy-5-methylfuran-2-one?
The canonical SMILES for 5-[(1E,3E)-hexa-1,3-dienyl]-3-(2-hydroxybutanoyl)-4-methoxy-5-methylfuran-2-one is CC/C=C/C=C/C1(C)OC(=O)C(C(=O)C(O)CC)=C1OC.
What is the InChIKey of 5-[(1E,3E)-hexa-1,3-dienyl]-3-(2-hydroxybutanoyl)-4-methoxy-5-methylfuran-2-one?
The InChIKey is WTWOEAFZDICZQF-XBLVEGMJSA-N. The full InChI is InChI=1S/C16H22O5/c1-5-7-8-9-10-16(3)14(20-4)12(15(19)21-16)13(18)11(17)6-2/h7-11,17H,5-6H2,1-4H3/b8-7+,10-9+.
What are the key properties of 5-[(1E,3E)-hexa-1,3-dienyl]-3-(2-hydroxybutanoyl)-4-methoxy-5-methylfuran-2-one?
5-[(1E,3E)-hexa-1,3-dienyl]-3-(2-hydroxybutanoyl)-4-methoxy-5-methylfuran-2-one has a molecular weight of 294.35 g/mol, XLogP of 2.06, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(1E,3E)-hexa-1,3-dienyl]-3-(2-hydroxybutanoyl)-4-methoxy-5-methylfuran-2-one is sourced from PubChem (CID 90473370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).