About 8,9-dihydrocyclopenta[a]acenaphthylen-9-ide;1,4-diphenylquinolin-1-ium
8,9-dihydrocyclopenta[a]acenaphthylen-9-ide;1,4-diphenylquinolin-1-ium (PubChem CID 90473671) has the molecular formula C36H25N
and a molecular weight of 471.60 g/mol. Its IUPAC name is 8,9-dihydrocyclopenta[a]acenaphthylen-9-ide;1,4-diphenylquinolin-1-ium.
Molecular Properties
| Compound Name | 8,9-dihydrocyclopenta[a]acenaphthylen-9-ide;1,4-diphenylquinolin-1-ium |
| PubChem CID | 90473671 |
| Molecular Formula | C36H25N |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | 8,9-dihydrocyclopenta[a]acenaphthylen-9-ide;1,4-diphenylquinolin-1-ium |
| SMILES | [C-]1=C2C(=CC1)c1cccc3cccc2c13.c1ccc(-c2cc[n+](-c3ccccc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C21H16N.C15H9/c1-3-9-17(10-4-1)19-15-16-22(18-11-5-2-6-12-18)21-14-8-7-13-20(19)21;1-4-10-5-2-9-14-12-7-3-6-11(12)13(8-1)15(10)14/h1-16H;1-2,4-6,8-9H,3H2/q+1;-1 |
| InChIKey | SUSQDBIQKSFCAA-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 8,9-dihydrocyclopenta[a]acenaphthylen-9-ide;1,4-diphenylquinolin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8,9-dihydrocyclopenta[a]acenaphthylen-9-ide;1,4-diphenylquinolin-1-ium?
The IUPAC name of 8,9-dihydrocyclopenta[a]acenaphthylen-9-ide;1,4-diphenylquinolin-1-ium (CID 90473671) is 8,9-dihydrocyclopenta[a]acenaphthylen-9-ide;1,4-diphenylquinolin-1-ium.
What is the SMILES notation for 8,9-dihydrocyclopenta[a]acenaphthylen-9-ide;1,4-diphenylquinolin-1-ium?
The canonical SMILES for 8,9-dihydrocyclopenta[a]acenaphthylen-9-ide;1,4-diphenylquinolin-1-ium is [C-]1=C2C(=CC1)c1cccc3cccc2c13.c1ccc(-c2cc[n+](-c3ccccc3)c3ccccc23)cc1.
What is the InChIKey of 8,9-dihydrocyclopenta[a]acenaphthylen-9-ide;1,4-diphenylquinolin-1-ium?
The InChIKey is SUSQDBIQKSFCAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16N.C15H9/c1-3-9-17(10-4-1)19-15-16-22(18-11-5-2-6-12-18)21-14-8-7-13-20(19)21;1-4-10-5-2-9-14-12-7-3-6-11(12)13(8-1)15(10)14/h1-16H;1-2,4-6,8-9H,3H2/q+1;-1.
What are the key properties of 8,9-dihydrocyclopenta[a]acenaphthylen-9-ide;1,4-diphenylquinolin-1-ium?
8,9-dihydrocyclopenta[a]acenaphthylen-9-ide;1,4-diphenylquinolin-1-ium has a molecular weight of 471.60 g/mol, XLogP of 8.61, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 8,9-dihydrocyclopenta[a]acenaphthylen-9-ide;1,4-diphenylquinolin-1-ium is sourced from PubChem (CID 90473671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).