C15H18O2 — CID 90473733
(5Z,9Z)-3,6,10-trimethyl-7,8-dihydro-4H-cyclodeca[b]furan-11-one (PubChem CID 90473733) has the molecular formula C15H18O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is (5Z,9Z)-3,6,10-trimethyl-7,8-dihydro-4H-cyclodeca[b]furan-11-one.
| Compound Name | (5Z,9Z)-3,6,10-trimethyl-7,8-dihydro-4H-cyclodeca[b]furan-11-one |
|---|---|
| PubChem CID | 90473733 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | (5Z,9Z)-3,6,10-trimethyl-7,8-dihydro-4H-cyclodeca[b]furan-11-one |
| SMILES | C/C1=C/Cc2c(C)coc2C(=O)/C(C)=C\CC1 |
| InChI | InChI=1S/C15H18O2/c1-10-5-4-6-11(2)14(16)15-13(8-7-10)12(3)9-17-15/h6-7,9H,4-5,8H2,1-3H3/b10-7-,11-6- |
| InChIKey | HPDPXMXGOKJKHX-LXQMTTSMSA-N |
| XLogP | 4.00 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|