About disodium;2,6-dibromo-4-[2-(3,5-dibromo-4-oxidophenyl)propan-2-yl]phenolate
disodium;2,6-dibromo-4-[2-(3,5-dibromo-4-oxidophenyl)propan-2-yl]phenolate (PubChem CID 90473794) has the molecular formula C15H10Br4Na2O2
and a molecular weight of 587.84 g/mol. Its IUPAC name is disodium;2,6-dibromo-4-[2-(3,5-dibromo-4-oxidophenyl)propan-2-yl]phenolate.
Molecular Properties
| Compound Name | disodium;2,6-dibromo-4-[2-(3,5-dibromo-4-oxidophenyl)propan-2-yl]phenolate |
| PubChem CID | 90473794 |
| Molecular Formula | C15H10Br4Na2O2 |
| Molecular Weight | 587.84 g/mol |
| Exact Mass | 583.72 |
| IUPAC Name | disodium;2,6-dibromo-4-[2-(3,5-dibromo-4-oxidophenyl)propan-2-yl]phenolate |
| SMILES | CC(C)(c1cc(Br)c([O-])c(Br)c1)c1cc(Br)c([O-])c(Br)c1.[Na+].[Na+] |
| InChI | InChI=1S/C15H12Br4O2.2Na/c1-15(2,7-3-9(16)13(20)10(17)4-7)8-5-11(18)14(21)12(19)6-8;;/h3-6,20-21H,1-2H3;;/q;2*+1/p-2 |
| InChIKey | AIBSRDJPPMFMBQ-UHFFFAOYSA-L |
| XLogP | -0.78 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 587.84 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze disodium;2,6-dibromo-4-[2-(3,5-dibromo-4-oxidophenyl)propan-2-yl]phenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;2,6-dibromo-4-[2-(3,5-dibromo-4-oxidophenyl)propan-2-yl]phenolate?
The IUPAC name of disodium;2,6-dibromo-4-[2-(3,5-dibromo-4-oxidophenyl)propan-2-yl]phenolate (CID 90473794) is disodium;2,6-dibromo-4-[2-(3,5-dibromo-4-oxidophenyl)propan-2-yl]phenolate.
What is the SMILES notation for disodium;2,6-dibromo-4-[2-(3,5-dibromo-4-oxidophenyl)propan-2-yl]phenolate?
The canonical SMILES for disodium;2,6-dibromo-4-[2-(3,5-dibromo-4-oxidophenyl)propan-2-yl]phenolate is CC(C)(c1cc(Br)c([O-])c(Br)c1)c1cc(Br)c([O-])c(Br)c1.[Na+].[Na+].
What is the InChIKey of disodium;2,6-dibromo-4-[2-(3,5-dibromo-4-oxidophenyl)propan-2-yl]phenolate?
The InChIKey is AIBSRDJPPMFMBQ-UHFFFAOYSA-L. The full InChI is InChI=1S/C15H12Br4O2.2Na/c1-15(2,7-3-9(16)13(20)10(17)4-7)8-5-11(18)14(21)12(19)6-8;;/h3-6,20-21H,1-2H3;;/q;2*+1/p-2.
What are the key properties of disodium;2,6-dibromo-4-[2-(3,5-dibromo-4-oxidophenyl)propan-2-yl]phenolate?
disodium;2,6-dibromo-4-[2-(3,5-dibromo-4-oxidophenyl)propan-2-yl]phenolate has a molecular weight of 587.84 g/mol, XLogP of -0.78, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;2,6-dibromo-4-[2-(3,5-dibromo-4-oxidophenyl)propan-2-yl]phenolate is sourced from PubChem (CID 90473794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).