C14H26O6 — CID 90474014
[(2R)-2-[(2R,3R,4S)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyethyl] octanoate (PubChem CID 90474014) has the molecular formula C14H26O6 and a molecular weight of 290.36 g/mol. Its IUPAC name is [(2R)-2-[(2R,3R,4S)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyethyl] octanoate.
| Compound Name | [(2R)-2-[(2R,3R,4S)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyethyl] octanoate |
|---|---|
| PubChem CID | 90474014 |
| Molecular Formula | C14H26O6 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | [(2R)-2-[(2R,3R,4S)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyethyl] octanoate |
| SMILES | CCCCCCCC(=O)OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O |
| InChI | InChI=1S/C14H26O6/c1-2-3-4-5-6-7-12(17)19-9-11(16)14-13(18)10(15)8-20-14/h10-11,13-16,18H,2-9H2,1H3/t10-,11+,13+,14+/m0/s1 |
| InChIKey | NENOAJSZZPODGJ-OIMNJJJWSA-N |
| XLogP | 0.37 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|