C22H28O8 — CID 90474242
[(3aS,4S,5R,6R,8Z,10R,11aR)-4-acetyloxy-6-hydroxy-6,10-dimethyl-3-methylidene-2,7-dioxo-3a,4,5,10,11,11a-hexahydrocyclodeca[b]furan-5-yl] (Z)-2-methylbut-2-enoate (PubChem CID 90474242) has the molecular formula C22H28O8 and a molecular weight of 420.46 g/mol. Its IUPAC name is [(3aS,4S,5R,6R,8Z,10R,11aR)-4-acetyloxy-6-hydroxy-6,10-dimethyl-3-methylidene-2,7-dioxo-3a,4,5,10,11,11a-hexahydrocyclodeca[b]furan-5-yl] (Z)-2-methylbut-2-enoate.
| Compound Name | [(3aS,4S,5R,6R,8Z,10R,11aR)-4-acetyloxy-6-hydroxy-6,10-dimethyl-3-methylidene-2,7-dioxo-3a,4,5,10,11,11a-hexahydrocyclodeca[b]furan-5-yl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 90474242 |
| Molecular Formula | C22H28O8 |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | [(3aS,4S,5R,6R,8Z,10R,11aR)-4-acetyloxy-6-hydroxy-6,10-dimethyl-3-methylidene-2,7-dioxo-3a,4,5,10,11,11a-hexahydrocyclodeca[b]furan-5-yl] (Z)-2-methylbut-2-enoate |
| SMILES | C=C1C(=O)O[C@@H]2C[C@@H](C)/C=C\C(=O)[C@](C)(O)[C@H](OC(=O)/C(C)=C\C)[C@@H](OC(C)=O)[C@@H]12 |
| InChI | InChI=1S/C22H28O8/c1-7-12(3)20(25)30-19-18(28-14(5)23)17-13(4)21(26)29-15(17)10-11(2)8-9-16(24)22(19,6)27/h7-9,11,15,17-19,27H,4,10H2,1-3,5-6H3/b9-8-,12-7-/t11-,15+,17-,18-,19+,22-/m0/s1 |
| InChIKey | SQSXFUQNHWCTLO-MBWLHKRJSA-N |
| XLogP | 1.81 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|